4,4-diethyl-9,10-dihydroxy-5,8-dihydroanthracen-1(4H)-one

ID: ALA4780580

PubChem CID: 162662779

Max Phase: Preclinical

Molecular Formula: C18H20O3

Molecular Weight: 284.36

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCC1(CC)C=CC(=O)c2c(O)c3c(c(O)c21)CC=CC3

Standard InChI:  InChI=1S/C18H20O3/c1-3-18(4-2)10-9-13(19)14-15(18)17(21)12-8-6-5-7-11(12)16(14)20/h5-6,9-10,20-21H,3-4,7-8H2,1-2H3

Standard InChI Key:  OCWXDHWECFDKQS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 21 23  0  0  0  0  0  0  0  0999 V2000
   29.1960   -4.2552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7915   -3.5453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3785   -4.2526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3674   -3.5521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0791   -3.1349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5000   -3.1311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4953   -2.3049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0783   -2.3117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7863   -1.9030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7832   -1.0868    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.3643   -1.0963    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.3708   -1.9111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3693   -4.3734    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.6552   -3.1390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6593   -2.3153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9514   -1.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2349   -2.3082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2307   -3.1319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9432   -3.5516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7834   -4.9605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0132   -4.2598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
 14  4  1  0
  4  5  2  0
 12 15  1  0
  8  5  1  0
  5  2  1  0
  2  6  1  0
  6  7  2  0
  7  9  1  0
  8  9  1  0
  9 10  2  0
 11 12  1  0
 12  8  2  0
  4 13  1  0
 14 15  2  0
 14 19  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
  3 20  1  0
  1 21  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4780580

    ---

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 284.36Molecular Weight (Monoisotopic): 284.1412AlogP: 3.56#Rotatable Bonds: 2
Polar Surface Area: 57.53Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 8.61CX Basic pKa: CX LogP: 4.89CX LogD: 4.86
Aromatic Rings: 1Heavy Atoms: 21QED Weighted: 0.64Np Likeness Score: 1.53

References

1. Méndez D,Urra FA,Millas-Vargas JP,Alarcón M,Rodríguez-Lavado J,Palomo I,Trostchansky A,Araya-Maturana R,Fuentes E.  (2020)  Synthesis of antiplatelet ortho-carbonyl hydroquinones with differential action on platelet aggregation stimulated by collagen or TRAP-6.,  192  [PMID:32155530] [10.1016/j.ejmech.2020.112187]

Source