Flustrimidazole A

ID: ALA4784993

PubChem CID: 162666048

Max Phase: Preclinical

Molecular Formula: C15H25N3O2

Molecular Weight: 279.38

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C/C(=C\C(=O)NCCc1c[nH]cn1)CCCC(C)(C)O

Standard InChI:  InChI=1S/C15H25N3O2/c1-12(5-4-7-15(2,3)20)9-14(19)17-8-6-13-10-16-11-18-13/h9-11,20H,4-8H2,1-3H3,(H,16,18)(H,17,19)/b12-9+

Standard InChI Key:  IDYOJBBLCRCNLF-FMIVXFBMSA-N

Molfile:  

 
     RDKit          2D

 20 20  0  0  0  0  0  0  0  0999 V2000
   37.6321  -26.1708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3398  -25.7622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0475  -26.1708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7552  -25.7622    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.4629  -26.1708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1706  -25.7622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8783  -26.1708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.5860  -25.7622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8783  -26.9879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.2937  -26.1708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.0097  -25.7622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.7092  -26.1708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.4169  -25.7622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.7092  -26.9879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.4119  -26.5752    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.4629  -26.9879    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.8837  -25.8425    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.3369  -26.4498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7455  -27.1576    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.5448  -26.9876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  7  9  1  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 12 14  1  0
 12 15  1  0
  5 16  2  0
  1 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 20  1  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4784993

    ---

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 279.38Molecular Weight (Monoisotopic): 279.1947AlogP: 1.96#Rotatable Bonds: 8
Polar Surface Area: 78.01Molecular Species: NEUTRALHBA: 3HBD: 3
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 13.10CX Basic pKa: 6.55CX LogP: 1.10CX LogD: 1.05
Aromatic Rings: 1Heavy Atoms: 20QED Weighted: 0.64Np Likeness Score: 0.66

References

1. Di X,Wang S,Oskarsson JT,Rouger C,Tasdemir D,Hardardottir I,Freysdottir J,Wang X,Molinski TF,Omarsdottir S.  (2020)  Bromotryptamine and Imidazole Alkaloids with Anti-inflammatory Activity from the Bryozoan Flustra foliacea.,  83  (10): [PMID:33016699] [10.1021/acs.jnatprod.0c00126]

Source