Deformylflustrabromine B trifluoroacetic acid

ID: ALA4789307

PubChem CID: 162669345

Max Phase: Preclinical

Molecular Formula: C18H22BrF3N2O2

Molecular Weight: 321.26

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CNCCc1cn(CC=C(C)C)c2cc(Br)ccc12.O=C(O)C(F)(F)F

Standard InChI:  InChI=1S/C16H21BrN2.C2HF3O2/c1-12(2)7-9-19-11-13(6-8-18-3)15-5-4-14(17)10-16(15)19;3-2(4,5)1(6)7/h4-5,7,10-11,18H,6,8-9H2,1-3H3;(H,6,7)

Standard InChI Key:  ASVBUUIBUNQLHM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 26 26  0  0  0  0  0  0  0  0999 V2000
   43.6623  -15.3248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.3700  -15.7334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.0777  -15.3248    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   44.3700  -16.5506    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   45.0719  -16.1379    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   43.6623  -14.5076    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.9546  -15.7334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.5910  -14.1529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5898  -14.9802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3045  -15.3930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3027  -13.7401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0180  -14.1493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0230  -14.9802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8147  -15.2323    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.2992  -14.5572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8068  -13.8879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8750  -15.3920    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   41.0572  -13.1019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5016  -12.4920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7519  -11.7061    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.5578  -11.5298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.0742  -16.0155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8821  -16.1822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1415  -16.9653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.9495  -17.1321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.5932  -17.5816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  1  0
  2  5  1  0
  1  6  2  0
  1  7  1  0
  8  9  2  0
  9 10  1  0
 10 13  2  0
 12 11  2  0
 11  8  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 12  1  0
  9 17  1  0
 16 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 14 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 24 26  1  0
M  END

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 321.26Molecular Weight (Monoisotopic): 320.0888AlogP: 4.13#Rotatable Bonds: 5
Polar Surface Area: 16.96Molecular Species: BASEHBA: 2HBD: 1
#RO5 Violations: HBA (Lipinski): 2HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 10.30CX LogP: 4.27CX LogD: 1.54
Aromatic Rings: 2Heavy Atoms: 19QED Weighted: 0.82Np Likeness Score: -0.01

References

1. Di X,Wang S,Oskarsson JT,Rouger C,Tasdemir D,Hardardottir I,Freysdottir J,Wang X,Molinski TF,Omarsdottir S.  (2020)  Bromotryptamine and Imidazole Alkaloids with Anti-inflammatory Activity from the Bryozoan Flustra foliacea.,  83  (10): [PMID:33016699] [10.1021/acs.jnatprod.0c00126]

Source