5-(3,4-dimethoxyphenyl)-7-[2-(3,4-dimethoxyphenyl)vinyl]-2-methyl-5H-thiazolo[3,2-a]pyrimidine

ID: ALA4790526

PubChem CID: 162671270

Max Phase: Preclinical

Molecular Formula: C25H26N2O4S

Molecular Weight: 450.56

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(/C=C/C2=CC(c3ccc(OC)c(OC)c3)N3C=C(C)SC3=N2)cc1OC

Standard InChI:  InChI=1S/C25H26N2O4S/c1-16-15-27-20(18-8-11-22(29-3)24(13-18)31-5)14-19(26-25(27)32-16)9-6-17-7-10-21(28-2)23(12-17)30-4/h6-15,20H,1-5H3/b9-6+

Standard InChI Key:  GMYYFFUTMVMGEF-RMKNXTFCSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
    2.5533  -10.5285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5522  -11.3481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2602  -11.7570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9699  -11.3476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9671  -10.5249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2584  -10.1197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6732  -10.1137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3825  -10.5196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0886  -10.1083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7965  -10.5170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5005  -10.1092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0824   -9.2930    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.2076  -10.5161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2063  -11.3344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9132  -11.7430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6219  -11.3343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6192  -10.5129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9118  -10.1081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7926   -8.8835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4977   -9.2930    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1050   -8.7490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7753   -8.0032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9642   -8.0865    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   10.3255  -10.1018    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.3301  -11.7420    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8455  -10.1201    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8442  -11.7561    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1368  -11.3469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1379  -10.5289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3312  -12.5592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3226   -9.2846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1856   -7.2965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
  9 12  1  0
 10 11  1  0
 11 20  1  0
 19 12  2  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 11 13  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 19  1  0
 17 24  1  0
 16 25  1  0
  1 26  1  0
  2 27  1  0
 27 28  1  0
 26 29  1  0
 25 30  1  0
 24 31  1  0
 22 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4790526

    ---

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 450.56Molecular Weight (Monoisotopic): 450.1613AlogP: 5.64#Rotatable Bonds: 7
Polar Surface Area: 52.52Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 5.16CX LogP: 4.17CX LogD: 4.17
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.54Np Likeness Score: -0.02

References

1. Al-Rashood ST,Elshahawy SS,El-Qaias AM,El-Behedy DS,Hassanin AA,El-Sayed SM,El-Messery SM,Shaldam MA,Hassan GS.  (2020)  New thiazolopyrimidine as anticancer agents: Synthesis, biological evaluation, DNA binding, molecular modeling and ADMET study.,  30  (23.0): [PMID:33068712] [10.1016/j.bmcl.2020.127611]

Source