The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(3,4-dimethoxyphenyl)-7-[2-(3,4-dimethoxyphenyl)vinyl]-2-methyl-5H-thiazolo[3,2-a]pyrimidine ID: ALA4790526
PubChem CID: 162671270
Max Phase: Preclinical
Molecular Formula: C25H26N2O4S
Molecular Weight: 450.56
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(/C=C/C2=CC(c3ccc(OC)c(OC)c3)N3C=C(C)SC3=N2)cc1OC
Standard InChI: InChI=1S/C25H26N2O4S/c1-16-15-27-20(18-8-11-22(29-3)24(13-18)31-5)14-19(26-25(27)32-16)9-6-17-7-10-21(28-2)23(12-17)30-4/h6-15,20H,1-5H3/b9-6+
Standard InChI Key: GMYYFFUTMVMGEF-RMKNXTFCSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
2.5533 -10.5285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5522 -11.3481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2602 -11.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9699 -11.3476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9671 -10.5249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2584 -10.1197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6732 -10.1137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3825 -10.5196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0886 -10.1083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7965 -10.5170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5005 -10.1092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0824 -9.2930 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2076 -10.5161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2063 -11.3344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9132 -11.7430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6219 -11.3343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6192 -10.5129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9118 -10.1081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7926 -8.8835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4977 -9.2930 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1050 -8.7490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7753 -8.0032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9642 -8.0865 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.3255 -10.1018 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3301 -11.7420 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8455 -10.1201 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8442 -11.7561 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1368 -11.3469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1379 -10.5289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3312 -12.5592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3226 -9.2846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1856 -7.2965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
9 12 1 0
10 11 1 0
11 20 1 0
19 12 2 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
11 13 1 0
19 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 19 1 0
17 24 1 0
16 25 1 0
1 26 1 0
2 27 1 0
27 28 1 0
26 29 1 0
25 30 1 0
24 31 1 0
22 32 1 0
M END Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 450.56Molecular Weight (Monoisotopic): 450.1613AlogP: 5.64#Rotatable Bonds: 7Polar Surface Area: 52.52Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 5.16CX LogP: 4.17CX LogD: 4.17Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.54Np Likeness Score: -0.02
References 1. Al-Rashood ST,Elshahawy SS,El-Qaias AM,El-Behedy DS,Hassanin AA,El-Sayed SM,El-Messery SM,Shaldam MA,Hassan GS. (2020) New thiazolopyrimidine as anticancer agents: Synthesis, biological evaluation, DNA binding, molecular modeling and ADMET study., 30 (23.0): [PMID:33068712 ] [10.1016/j.bmcl.2020.127611 ]