3-methyl-5-(p-tolyl)-7-[2-(p-tolyl)vinyl]-5H-thiazolo[3,2-a]pyrimidine

ID: ALA4793179

PubChem CID: 162671969

Max Phase: Preclinical

Molecular Formula: C23H22N2S

Molecular Weight: 358.51

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1=CSC2=NC(/C=C/c3ccc(C)cc3)=CC(c3ccc(C)cc3)N12

Standard InChI:  InChI=1S/C23H22N2S/c1-16-4-8-19(9-5-16)10-13-21-14-22(20-11-6-17(2)7-12-20)25-18(3)15-26-23(25)24-21/h4-15,22H,1-3H3/b13-10+

Standard InChI Key:  SHOOADDFKPDHNC-JLHYYAGUSA-N

Molfile:  

 
     RDKit          2D

 26 29  0  0  0  0  0  0  0  0999 V2000
    2.4956  -14.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4944  -15.6362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2025  -16.0452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9121  -15.6358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9093  -14.8131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2007  -14.4079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6155  -14.4019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3247  -14.8078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0309  -14.3965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7387  -14.8051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4428  -14.3974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0246  -13.5812    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1499  -14.8043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1485  -15.6226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8554  -16.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5641  -15.6225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5615  -14.8011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8540  -14.3963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7348  -13.1717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4399  -13.5812    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0472  -13.0372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7175  -12.2914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9064  -12.3747    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.7864  -16.0443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2723  -16.0302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8461  -13.2091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
  9 12  1  0
 10 11  1  0
 11 20  1  0
 19 12  2  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 11 13  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 19  1  0
  2 24  1  0
 16 25  1  0
 21 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4793179

    ---

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 358.51Molecular Weight (Monoisotopic): 358.1504AlogP: 6.22#Rotatable Bonds: 3
Polar Surface Area: 15.60Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 5.08CX LogP: 5.75CX LogD: 5.75
Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.65Np Likeness Score: -0.36

References

1. Al-Rashood ST,Elshahawy SS,El-Qaias AM,El-Behedy DS,Hassanin AA,El-Sayed SM,El-Messery SM,Shaldam MA,Hassan GS.  (2020)  New thiazolopyrimidine as anticancer agents: Synthesis, biological evaluation, DNA binding, molecular modeling and ADMET study.,  30  (23.0): [PMID:33068712] [10.1016/j.bmcl.2020.127611]

Source