Na-methyldeformylflustrabromine trifluoroacetic acid

ID: ALA4796008

PubChem CID: 162674236

Max Phase: Preclinical

Molecular Formula: C19H24BrF3N2O2

Molecular Weight: 335.29

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=CC(C)(C)c1c(CCNC)c2ccc(Br)cc2n1C.O=C(O)C(F)(F)F

Standard InChI:  InChI=1S/C17H23BrN2.C2HF3O2/c1-6-17(2,3)16-14(9-10-19-4)13-8-7-12(18)11-15(13)20(16)5;3-2(4,5)1(6)7/h6-8,11,19H,1,9-10H2,2-5H3;(H,6,7)

Standard InChI Key:  TWXYKXUFTKLNAQ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 27 27  0  0  0  0  0  0  0  0999 V2000
   21.7998  -28.1418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5075  -28.5504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2152  -28.1418    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   22.5075  -29.3676    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   23.2094  -28.9548    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   21.7998  -27.3246    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.0921  -28.5504    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.0270  -26.6571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0259  -27.4844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7406  -27.8973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7388  -26.2443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4542  -26.6535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4591  -27.4844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2509  -27.7367    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.7355  -27.0614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2431  -26.3921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3111  -27.8963    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   18.4933  -25.6060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9377  -24.9962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1880  -24.2102    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.5104  -28.5198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5604  -27.0566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9687  -26.3397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9771  -27.7686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3824  -27.0529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7918  -26.3367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9939  -24.0339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  1  0
  2  5  1  0
  1  6  2  0
  1  7  1  0
  8  9  2  0
  9 10  1  0
 10 13  2  0
 12 11  2  0
 11  8  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 12  1  0
  9 17  1  0
 16 18  1  0
 18 19  1  0
 19 20  1  0
 14 21  1  0
 15 22  1  0
 22 23  1  0
 22 24  1  0
 22 25  1  0
 25 26  2  0
 20 27  1  0
M  END

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 335.29Molecular Weight (Monoisotopic): 334.1045AlogP: 4.17#Rotatable Bonds: 5
Polar Surface Area: 16.96Molecular Species: BASEHBA: 2HBD: 1
#RO5 Violations: HBA (Lipinski): 2HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 10.25CX LogP: 4.52CX LogD: 1.82
Aromatic Rings: 2Heavy Atoms: 20QED Weighted: 0.81Np Likeness Score: 0.34

References

1. Di X,Wang S,Oskarsson JT,Rouger C,Tasdemir D,Hardardottir I,Freysdottir J,Wang X,Molinski TF,Omarsdottir S.  (2020)  Bromotryptamine and Imidazole Alkaloids with Anti-inflammatory Activity from the Bryozoan Flustra foliacea.,  83  (10): [PMID:33016699] [10.1021/acs.jnatprod.0c00126]

Source