2-methoxy-3,5-dimethyl-6-((1R,3'S,5'R,6S,8R)-1,3,5-trimethyl-8-(4-nitrophenyl)-4',5'-dihydro-2'H-spiro[bicyclo[4.2.0]octa[2,4]diene-7,3'-furan]-5'-yl)-4H-pyran-4-one

ID: ALA514407

PubChem CID: 9912904

Max Phase: Preclinical

Molecular Formula: C28H31NO6

Molecular Weight: 477.56

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Synonyms: SNF-4435C | SNF4435C|2-Methoxy-3,5-dimethyl-6-[(1R,2'R,6S,7S,8R)-1,3,5-trimethyl-8-(4-nitrophenyl)spiro[bicyclo[4.2.0]octa-2,4-diene-7,4'-oxolane]-2'-yl]pyran-4-one|CHEMBL514407|SCHEMBL12632512|SNF-4435C|CHEBI:216362

Canonical SMILES:  COc1oc([C@H]2C[C@@]3(CO2)[C@H](c2ccc([N+](=O)[O-])cc2)[C@]2(C)C=C(C)C=C(C)[C@@H]23)c(C)c(=O)c1C

Standard InChI:  InChI=1S/C28H31NO6/c1-15-11-16(2)24-27(5,12-15)25(19-7-9-20(10-8-19)29(31)32)28(24)13-21(34-14-28)23-17(3)22(30)18(4)26(33-6)35-23/h7-12,21,24-25H,13-14H2,1-6H3/t21-,24+,25-,27-,28+/m1/s1

Standard InChI Key:  DXCYJJKWPZZHNZ-PAWAVCGOSA-N

Molfile:  

     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   -1.5077   -5.4887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6823   -5.4887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4280   -4.7038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0971   -4.2205    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7619   -4.7038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3337   -5.4907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5083   -6.3161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3309   -6.3122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7449   -7.0260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3339   -7.7360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5065   -7.7379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0981   -7.0233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1334   -6.0970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2728   -7.0259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7446   -8.4515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9175   -4.9087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7035   -4.1134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2861   -3.5320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0823   -3.7451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2951   -4.5437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7101   -5.1241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6731   -3.1602    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4674   -3.3753    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4597   -2.3644    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3569   -4.4496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9660   -5.0012    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7466   -4.7515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9222   -3.9460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3076   -3.3910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5214   -3.6412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0910   -3.0902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3590   -5.3070    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1809   -6.1123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7085   -3.6921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4851   -2.5855    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6830   -6.3161    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  1  5  1  1
  6  8  1  0
  7  1  1  0
  1  6  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
  7 12  1  0
  8 13  1  6
 12 14  1  0
 10 15  1  0
  6 16  1  1
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 22 23  2  0
 22 24  1  0
 19 22  1  0
  3 25  1  1
 25 26  1  0
 25 30  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 27 32  1  0
 32 33  1  0
 28 34  1  0
 29 35  2  0
  7 36  1  6
M  CHG  2  22   1  24  -1
M  END

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 477.56Molecular Weight (Monoisotopic): 477.2151AlogP: 5.95#Rotatable Bonds: 4
Polar Surface Area: 91.81Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.04CX LogD: 5.04
Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.40Np Likeness Score: 0.93

References

1. Wilk W, Waldmann H, Kaiser M..  (2009)  Gamma-pyrone natural products--a privileged compound class provided by nature.,  17  (6): [PMID:19042133] [10.1016/j.bmc.2008.11.001]

Source