11beta,13-dihydrodesacylcynaropicrin

ID: ALA5172465

PubChem CID: 12047617

Max Phase: Preclinical

Molecular Formula: C15H20O4

Molecular Weight: 264.32

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=C1[C@@H]2[C@H]3OC(=O)[C@@H](C)[C@@H]3[C@@H](O)CC(=C)[C@@H]2C[C@@H]1O

Standard InChI:  InChI=1S/C15H20O4/c1-6-4-11(17)13-8(3)15(18)19-14(13)12-7(2)10(16)5-9(6)12/h8-14,16-17H,1-2,4-5H2,3H3/t8-,9-,10-,11-,12-,13+,14+/m0/s1

Standard InChI Key:  AEWOONBLAKEKSC-CLSQCYNNSA-N

Molfile:  

 
     RDKit          2D

 23 25  0  0  0  0  0  0  0  0999 V2000
   -2.4008    0.5659    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5758    0.5659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0810    1.2372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2939    0.9900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4428    1.8014    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2939    0.1603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1025   -0.0912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3160   -0.8881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4457   -0.6506    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.3518   -0.3530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5346    0.4514    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1539   -0.1697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5109    0.5774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1534    1.3152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3518    1.4987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1382    2.2956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3360    0.5774    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9783   -0.1365    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.5758   -0.8958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0450   -1.4987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2867   -1.1687    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2585   -2.2956    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4008   -0.8958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  1
  3  2  1  0
  4  3  1  0
  4  5  1  6
  4  6  1  0
  6  7  1  0
  7  2  1  0
  7  8  2  0
  6  9  1  6
  6 10  1  0
 10 11  1  1
 12 10  1  0
 13 12  1  0
 14 13  1  0
 15 14  1  0
  4 15  1  0
 15 16  2  0
 13 17  1  6
 12 18  1  6
 12 19  1  0
 19 20  1  0
 21 20  1  0
 10 21  1  0
 20 22  2  0
 19 23  1  6
M  END

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 264.32Molecular Weight (Monoisotopic): 264.1362AlogP: 1.04#Rotatable Bonds:
Polar Surface Area: 66.76Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 0.36CX LogD: 0.36
Aromatic Rings: Heavy Atoms: 19QED Weighted: 0.51Np Likeness Score: 3.57

References

1. Tanaka N, Yoshino Y, Nakano F, Kurimoto SI, Kawazoe K, Tsuji D, Itoh K, Li SL, Sun HD, Takaishi Y, Kashiwada Y..  (2022)  Lanicepines A and B, Sesquiterpenes with Amino Acid-Derived Substituents from the Flowering Aerial Parts of Saussurea laniceps.,  85  (4.0): [PMID:35179378] [10.1021/acs.jnatprod.1c01069]

Source