The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-{[(3-{[3-(dimethylamino)propyl]amino}-6-nitroquinoxalin-2-yl)amino]methyl}benzonitrile ID: ALA5179793
PubChem CID: 168273304
Max Phase: Preclinical
Molecular Formula: C21H23N7O2
Molecular Weight: 405.46
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)CCCNc1nc2cc([N+](=O)[O-])ccc2nc1NCc1ccc(C#N)cc1
Standard InChI: InChI=1S/C21H23N7O2/c1-27(2)11-3-10-23-20-21(24-14-16-6-4-15(13-22)5-7-16)25-18-9-8-17(28(29)30)12-19(18)26-20/h4-9,12H,3,10-11,14H2,1-2H3,(H,23,26)(H,24,25)
Standard InChI Key: GWCHVPVKANTRFR-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
-3.2582 0.8171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2593 -0.0078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5463 -0.4196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8339 -0.0036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8346 0.8208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5481 1.2288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1260 1.2338 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.4120 0.8275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4072 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1205 -0.4134 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3065 -0.4085 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0176 0.0055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7318 -0.4029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7303 -1.2241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4437 -1.6327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1557 -1.2184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1498 -0.3914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4359 0.0133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2977 1.2434 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0128 0.8362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7229 1.2522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4380 0.8449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1481 1.2609 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8632 0.8537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1430 2.0836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9716 1.2281 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.6841 0.8166 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9718 2.0510 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8682 -1.6298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6841 -2.0836 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
5 4 1 0
6 1 1 0
5 6 2 0
7 5 1 0
8 7 2 0
9 8 1 0
4 10 1 0
10 9 2 0
9 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
8 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
23 25 1 0
1 26 1 0
26 27 2 0
26 28 1 0
16 29 1 0
29 30 3 0
M CHG 2 26 1 28 -1
M END Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 405.46Molecular Weight (Monoisotopic): 405.1913AlogP: 3.39#Rotatable Bonds: 9Polar Surface Area: 120.01Molecular Species: BASEHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.40CX LogP: 3.03CX LogD: 1.04Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.32Np Likeness Score: -1.69
References 1. Pal R, Chakraborty J, Mukhopadhyay TK, Kanungo A, Saha R, Chakraborty A, Patra D, Datta A, Dutta S.. (2022) Substituent effect of benzyl moiety in nitroquinoxaline small molecules upon DNA binding: Cumulative destacking of DNA nucleobases leading to histone eviction., 229 [PMID:34802835 ] [10.1016/j.ejmech.2021.113995 ]