2-Amino-8-ethyl-4-(2-methyl-1H-indol-3-yl)-6-(4-oxo-3,4-dihydroquinazolin-2-yl)-4H-chromene-3-carbonitrile

ID: ALA5278983

Max Phase: Preclinical

Molecular Formula: C29H23N5O2

Molecular Weight: 473.54

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCc1cc(-c2nc3ccccc3c(=O)[nH]2)cc2c1OC(N)=C(C#N)C2c1c(C)[nH]c2ccccc12

Standard InChI:  InChI=1S/C29H23N5O2/c1-3-16-12-17(28-33-23-11-7-5-9-19(23)29(35)34-28)13-20-25(21(14-30)27(31)36-26(16)20)24-15(2)32-22-10-6-4-8-18(22)24/h4-13,25,32H,3,31H2,1-2H3,(H,33,34,35)

Standard InChI Key:  BCVUSTSRWNAOBO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 41  0  0  0  0  0  0  0  0999 V2000
    3.2270   -1.5628    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5110   -1.1529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7898   -1.5687    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0756   -1.1563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0736   -0.3257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7893    0.0869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5091   -0.3221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2237    0.0898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9384    0.5018    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7847    0.9140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1107    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3645    2.1909    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1953    2.1942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4551    1.4051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2633    1.2398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8152    1.8538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5557    2.6419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7445    2.8162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3271    1.1420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3565    0.0839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3586   -0.3283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3576   -1.1580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3559   -1.5713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3594   -2.4013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0729    0.0844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7926   -0.3317    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5054    0.0862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5054    0.9158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7904    1.3274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0729    0.9139    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7904    2.1524    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2225    1.3265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9384    0.9158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9384    0.0862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2225   -0.3327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3591   -2.8162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  1  0
  5  4  2  0
  5  6  1  0
  2  7  2  0
  7  6  1  0
  7  8  1  0
  9  8  3  0
 10  6  1  0
 11 10  2  0
 12 11  1  0
 13 12  1  0
 14 13  2  0
 14 10  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 13 18  1  0
 19 11  1  0
  5 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
  4 23  1  0
 24 23  1  0
 25 21  1  0
 26 25  2  0
 27 26  1  0
 28 27  2  0
 28 29  1  0
 25 30  1  0
 30 29  1  0
 31 29  2  0
 28 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 27 35  1  0
 24 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5278983

    ---

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 473.54Molecular Weight (Monoisotopic): 473.1852AlogP: 5.16#Rotatable Bonds: 3
Polar Surface Area: 120.58Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 7.94CX Basic pKa: 4.11CX LogP: 4.94CX LogD: 4.85
Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.33Np Likeness Score: -0.78

References

1. Sardar A, Ansari A, Gupta S, Sinha S, Pandey S, Rai D, Kumar M, Bhatta RS, Trivedi R, Sashidhara KV..  (2022)  Design, synthesis and biological evaluation of new quinazolinone-benzopyran-indole hybrid compounds promoting osteogenesis through BMP2 upregulation.,  244  [PMID:36219902] [10.1016/j.ejmech.2022.114813]

Source