The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Amino-8-ethyl-4-(2-methyl-1H-indol-3-yl)-6-(4-oxo-3,4-dihydroquinazolin-2-yl)-4H-chromene-3-carbonitrile ID: ALA5278983
Max Phase: Preclinical
Molecular Formula: C29H23N5O2
Molecular Weight: 473.54
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCc1cc(-c2nc3ccccc3c(=O)[nH]2)cc2c1OC(N)=C(C#N)C2c1c(C)[nH]c2ccccc12
Standard InChI: InChI=1S/C29H23N5O2/c1-3-16-12-17(28-33-23-11-7-5-9-19(23)29(35)34-28)13-20-25(21(14-30)27(31)36-26(16)20)24-15(2)32-22-10-6-4-8-18(22)24/h4-13,25,32H,3,31H2,1-2H3,(H,33,34,35)
Standard InChI Key: BCVUSTSRWNAOBO-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 41 0 0 0 0 0 0 0 0999 V2000
3.2270 -1.5628 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5110 -1.1529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7898 -1.5687 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0756 -1.1563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0736 -0.3257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7893 0.0869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5091 -0.3221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2237 0.0898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9384 0.5018 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7847 0.9140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1107 1.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3645 2.1909 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1953 2.1942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4551 1.4051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2633 1.2398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8152 1.8538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5557 2.6419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7445 2.8162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3271 1.1420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3565 0.0839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3586 -0.3283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3576 -1.1580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3559 -1.5713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3594 -2.4013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0729 0.0844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7926 -0.3317 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5054 0.0862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5054 0.9158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7904 1.3274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0729 0.9139 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7904 2.1524 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2225 1.3265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9384 0.9158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9384 0.0862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2225 -0.3327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3591 -2.8162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 1 0
5 4 2 0
5 6 1 0
2 7 2 0
7 6 1 0
7 8 1 0
9 8 3 0
10 6 1 0
11 10 2 0
12 11 1 0
13 12 1 0
14 13 2 0
14 10 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
13 18 1 0
19 11 1 0
5 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
4 23 1 0
24 23 1 0
25 21 1 0
26 25 2 0
27 26 1 0
28 27 2 0
28 29 1 0
25 30 1 0
30 29 1 0
31 29 2 0
28 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
27 35 1 0
24 36 1 0
M END Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 473.54Molecular Weight (Monoisotopic): 473.1852AlogP: 5.16#Rotatable Bonds: 3Polar Surface Area: 120.58Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.94CX Basic pKa: 4.11CX LogP: 4.94CX LogD: 4.85Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.33Np Likeness Score: -0.78
References 1. Sardar A, Ansari A, Gupta S, Sinha S, Pandey S, Rai D, Kumar M, Bhatta RS, Trivedi R, Sashidhara KV.. (2022) Design, synthesis and biological evaluation of new quinazolinone-benzopyran-indole hybrid compounds promoting osteogenesis through BMP2 upregulation., 244 [PMID:36219902 ] [10.1016/j.ejmech.2022.114813 ]