2-Amino-4-(2-methyl-1H-indol-3-yl)-6-(3-methyl-4-oxo-3,4-dihydroquinazolin-2-yl)-8-propyl-4H-chromene-3-carbonitrile

ID: ALA5284498

Max Phase: Preclinical

Molecular Formula: C31H27N5O2

Molecular Weight: 501.59

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCc1cc(-c2nc3ccccc3c(=O)n2C)cc2c1OC(N)=C(C#N)C2c1c(C)[nH]c2ccccc12

Standard InChI:  InChI=1S/C31H27N5O2/c1-4-9-18-14-19(30-35-25-13-8-6-11-21(25)31(37)36(30)3)15-22-27(23(16-32)29(33)38-28(18)22)26-17(2)34-24-12-7-5-10-20(24)26/h5-8,10-15,27,34H,4,9,33H2,1-3H3

Standard InChI Key:  WDJIRJCLGOUBCY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 43  0  0  0  0  0  0  0  0999 V2000
    3.2272   -1.1480    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5113   -0.7381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7900   -1.1538    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0757   -0.7415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0736    0.0892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7895    0.5019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5093    0.0928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2240    0.5048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9387    0.9168    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7849    1.3291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1109    1.8150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3647    2.6060    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1955    2.6093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4553    1.8202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2636    1.6549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8154    2.2689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5560    3.0571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7447    3.2313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3271    1.5571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3565    0.4989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3585    0.0865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3576   -0.7432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3560   -1.1564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3595   -1.9865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0729    0.4993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7926    0.0832    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5056    0.5013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5056    1.3309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7905    1.7425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0729    1.3290    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7905    2.5675    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2227    1.7415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9387    1.3309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9387    0.5013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2227    0.0822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3591   -2.4015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3543    1.7439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3591   -3.2313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  1  0
  5  4  2  0
  5  6  1  0
  2  7  2  0
  7  6  1  0
  7  8  1  0
  9  8  3  0
 10  6  1  0
 11 10  2  0
 12 11  1  0
 13 12  1  0
 14 13  2  0
 14 10  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 13 18  1  0
 19 11  1  0
  5 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
  4 23  1  0
 24 23  1  0
 25 21  1  0
 26 25  2  0
 27 26  1  0
 28 27  2  0
 28 29  1  0
 25 30  1  0
 30 29  1  0
 31 29  2  0
 28 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 27 35  1  0
 24 36  1  0
 30 37  1  0
 36 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5284498

    ---

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 501.59Molecular Weight (Monoisotopic): 501.2165AlogP: 5.56#Rotatable Bonds: 4
Polar Surface Area: 109.72Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 4.35CX LogP: 5.61CX LogD: 5.61
Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.33Np Likeness Score: -0.68

References

1. Sardar A, Ansari A, Gupta S, Sinha S, Pandey S, Rai D, Kumar M, Bhatta RS, Trivedi R, Sashidhara KV..  (2022)  Design, synthesis and biological evaluation of new quinazolinone-benzopyran-indole hybrid compounds promoting osteogenesis through BMP2 upregulation.,  244  [PMID:36219902] [10.1016/j.ejmech.2022.114813]

Source