The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Amino-4-(5-chloro-2-methyl-1H-indol-3-yl)-8-isopropyl-6-(3-methyl-4-oxo-3,4-dihydroquinazolin-2-yl)-4H-chromene-3-carbonitrile ID: ALA5288900
Max Phase: Preclinical
Molecular Formula: C31H26ClN5O2
Molecular Weight: 536.04
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1[nH]c2ccc(Cl)cc2c1C1C(C#N)=C(N)Oc2c(C(C)C)cc(-c3nc4ccccc4c(=O)n3C)cc21
Standard InChI: InChI=1S/C31H26ClN5O2/c1-15(2)20-11-17(30-36-24-8-6-5-7-19(24)31(38)37(30)4)12-22-27(23(14-33)29(34)39-28(20)22)26-16(3)35-25-10-9-18(32)13-21(25)26/h5-13,15,27,35H,34H2,1-4H3
Standard InChI Key: YQXKTXGFDJKFMP-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 44 0 0 0 0 0 0 0 0999 V2000
2.8879 -1.5628 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1719 -1.1529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4507 -1.5687 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7365 -1.1563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7344 -0.3257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4502 0.0869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1700 -0.3221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8846 0.0898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5993 0.5018 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4456 0.9140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7716 1.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0254 2.1909 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8562 2.1942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1160 1.4051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9242 1.2398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4760 1.8538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2166 2.6419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4054 2.8162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0119 1.1420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0174 0.0839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6977 -0.3283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6967 -1.1580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0167 -1.5713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0203 -2.4013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4120 0.0844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1317 -0.3317 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8446 0.0862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8446 0.9158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1295 1.3274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4120 0.9139 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1295 2.1524 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.5616 1.3265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2776 0.9158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2776 0.0862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5616 -0.3327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7407 -2.8132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6983 -2.8162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6934 1.3288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2776 1.6390 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 1 0
5 4 2 0
5 6 1 0
2 7 2 0
7 6 1 0
7 8 1 0
9 8 3 0
10 6 1 0
11 10 2 0
12 11 1 0
13 12 1 0
14 13 2 0
14 10 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
13 18 1 0
19 11 1 0
5 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
4 23 1 0
24 23 1 0
25 21 1 0
26 25 2 0
27 26 1 0
28 27 2 0
28 29 1 0
25 30 1 0
30 29 1 0
31 29 2 0
28 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
27 35 1 0
24 36 1 0
24 37 1 0
30 38 1 0
16 39 1 0
M END Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 536.04Molecular Weight (Monoisotopic): 535.1775AlogP: 6.39#Rotatable Bonds: 3Polar Surface Area: 109.72Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 4.34CX LogP: 6.06CX LogD: 6.06Aromatic Rings: 5Heavy Atoms: 39QED Weighted: 0.28Np Likeness Score: -0.81
References 1. Sardar A, Ansari A, Gupta S, Sinha S, Pandey S, Rai D, Kumar M, Bhatta RS, Trivedi R, Sashidhara KV.. (2022) Design, synthesis and biological evaluation of new quinazolinone-benzopyran-indole hybrid compounds promoting osteogenesis through BMP2 upregulation., 244 [PMID:36219902 ] [10.1016/j.ejmech.2022.114813 ]