Plagiochilide

ID: ALA5290416

Max Phase: Preclinical

Molecular Formula: C15H20O2

Molecular Weight: 232.32

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=C1CC[C@H]2[C@@H]([C@H]3C(C)=COC(=O)[C@@H]13)C2(C)C

Standard InChI:  InChI=1S/C15H20O2/c1-8-5-6-10-13(15(10,3)4)11-9(2)7-17-14(16)12(8)11/h7,10-13H,1,5-6H2,2-4H3/t10-,11-,12-,13-/m0/s1

Standard InChI Key:  GBFVXZXYIVKIBN-CYDGBPFRSA-N

Molfile:  

 
     RDKit          2D

 21 23  0  0  0  0  0  0  0  0999 V2000
   -0.2974    0.7343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3506    1.2448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1550    1.0609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5138    0.3204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1555   -0.4293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3506   -0.6133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2974   -0.0982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9119   -1.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9119   -2.0426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6271   -1.6296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7395   -1.0133    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0623   -1.3285    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1368    2.0426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0185   -0.5145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7395   -0.0981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7395    0.7344    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0185    1.1507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2974    1.5602    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2974   -0.9240    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0185    1.9765    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0185   -1.3403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  1  7  1  0
  7  6  1  0
  5  8  1  0
  6  8  1  0
  8  9  1  0
  8 10  1  0
  5 11  1  1
  6 12  1  1
  2 13  2  0
  7 14  1  0
 15 14  2  0
 16 15  1  0
 17 16  1  0
  1 17  1  0
  1 18  1  6
  7 19  1  6
 17 20  2  0
 14 21  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5290416

    ---

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 232.32Molecular Weight (Monoisotopic): 232.1463AlogP: 3.30#Rotatable Bonds:
Polar Surface Area: 26.30Molecular Species: HBA: 2HBD:
#RO5 Violations: HBA (Lipinski): 2HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 2.74CX LogD: 2.74
Aromatic Rings: Heavy Atoms: 17QED Weighted: 0.47Np Likeness Score: 2.72

References

1. Asakawa Y, Ludwiczuk A..  (2018)  Chemical Constituents of Bryophytes: Structures and Biological Activity.,  81  (3): [PMID:29019405] [10.1021/acs.jnatprod.6b01046]

Source