2-Amino-4-(5-chloro-2-methyl-1H-indol-3-yl)-8-methyl-6-(3-methyl-4-oxo-3,4-dihydroquinazolin-2-yl)-4H-chromene-3-carbonitrile

ID: ALA5291244

Max Phase: Preclinical

Molecular Formula: C29H22ClN5O2

Molecular Weight: 507.98

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(-c2nc3ccccc3c(=O)n2C)cc2c1OC(N)=C(C#N)C2c1c(C)[nH]c2ccc(Cl)cc12

Standard InChI:  InChI=1S/C29H22ClN5O2/c1-14-10-16(28-34-22-7-5-4-6-18(22)29(36)35(28)3)11-20-25(21(13-31)27(32)37-26(14)20)24-15(2)33-23-9-8-17(30)12-19(23)24/h4-12,25,33H,32H2,1-3H3

Standard InChI Key:  PZCLPUOPASLNBC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 42  0  0  0  0  0  0  0  0999 V2000
    2.8879   -1.7703    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1719   -1.3603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4507   -1.7762    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7365   -1.3638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7344   -0.5331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4502   -0.1205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1700   -0.5295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8846   -0.1175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5993    0.2944    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4456    0.7066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7716    1.1925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0254    1.9835    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8562    1.9867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1160    1.1977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9242    1.0323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4760    1.6464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2166    2.4345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4054    2.6087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0119    0.9346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0174   -0.1235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6977   -0.5357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6967   -1.3654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0167   -1.7787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0203   -2.6087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4120   -0.1230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1317   -0.5391    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8446   -0.1211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8446    0.7084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1295    1.1200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4120    0.7065    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1295    1.9450    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5616    1.1190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2776    0.7084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2776   -0.1211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5616   -0.5401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6934    1.1214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2776    1.4316    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  1  0
  5  4  2  0
  5  6  1  0
  2  7  2  0
  7  6  1  0
  7  8  1  0
  9  8  3  0
 10  6  1  0
 11 10  2  0
 12 11  1  0
 13 12  1  0
 14 13  2  0
 14 10  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 13 18  1  0
 19 11  1  0
  5 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
  4 23  1  0
 24 23  1  0
 25 21  1  0
 26 25  2  0
 27 26  1  0
 28 27  2  0
 28 29  1  0
 25 30  1  0
 30 29  1  0
 31 29  2  0
 28 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 27 35  1  0
 30 36  1  0
 16 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5291244

    ---

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 507.98Molecular Weight (Monoisotopic): 507.1462AlogP: 5.57#Rotatable Bonds: 2
Polar Surface Area: 109.72Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 4.36CX LogP: 5.33CX LogD: 5.33
Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.32Np Likeness Score: -0.94

References

1. Sardar A, Ansari A, Gupta S, Sinha S, Pandey S, Rai D, Kumar M, Bhatta RS, Trivedi R, Sashidhara KV..  (2022)  Design, synthesis and biological evaluation of new quinazolinone-benzopyran-indole hybrid compounds promoting osteogenesis through BMP2 upregulation.,  244  [PMID:36219902] [10.1016/j.ejmech.2022.114813]

Source