NESVATEGRAST

ID: ALA5315046

Max Phase: Phase

Molecular Formula: C23H27F2N5O4

Molecular Weight: 475.50

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Synonyms from Alternative Forms(4): Nesvategrast isobutanolammonium | Ott166 | OTT-166 | SF-0166

Canonical SMILES:  O=C(O)C[C@@H](c1ccc(OC(F)F)nc1)N1CCN(CCCc2ccc3c(n2)NCCC3)C1=O

Standard InChI:  InChI=1S/C23H27F2N5O4/c24-22(25)34-19-8-6-16(14-27-19)18(13-20(31)32)30-12-11-29(23(30)33)10-2-4-17-7-5-15-3-1-9-26-21(15)28-17/h5-8,14,18,22H,1-4,9-13H2,(H,26,28)(H,31,32)/t18-/m0/s1

Standard InChI Key:  IGUVQCZYMKVWFL-SFHVURJKSA-N

Molfile:  

     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   -6.4995    5.5142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2139    5.1017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2139    4.2767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4995    3.8642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7850    4.2767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7850    5.1017    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4995    3.0392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7850    2.6267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0705    3.0392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0705    3.8642    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3561    2.6267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6416    3.0392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9271    2.6267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2127    3.0392    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2127    3.8642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4281    2.7842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9431    3.4517    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4280    4.1191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2720    4.9590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2129    4.2916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1227    3.5379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0636    5.7127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8841    5.7990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3690    5.1315    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0334    4.3778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2196    6.5526    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0401    6.6389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5250    5.9714    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.3757    7.3926    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.3623    2.8704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1827    2.9567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1732    1.9996    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6676    2.2892    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5183    3.7103    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  1  6  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
  4  7  1  0
  5 10  1  0
 11 12  1  0
  9 11  1  0
 13 14  1  0
 14 15  1  0
 12 13  1  0
 16 17  1  0
 17 18  1  0
 14 16  1  0
 15 18  1  0
 19 20  2  0
 21 20  1  6
 17 21  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 19 22  1  0
 20 25  1  0
 26 27  1  0
 27 28  1  0
 23 26  1  0
 27 29  1  0
 30 31  1  0
 21 30  1  0
 16 32  2  0
 31 33  2  0
 31 34  1  0
M  END

Alternative Forms

  1. Alternative Forms:

  2. Parent:

    ALA5315046

    NESVATEGRAST

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 475.50Molecular Weight (Monoisotopic): 475.2031AlogP: 3.32#Rotatable Bonds: 10
Polar Surface Area: 107.89Molecular Species: ACIDHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 4.14CX Basic pKa: 6.52CX LogP: 0.69CX LogD: -0.15
Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.54Np Likeness Score: -0.88

References

1. International Nonproprietary Names for Pharmaceutical Substances (INN),