The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
9-Acetyl-7-(4-amino-5-methoxy-6-methyl-tetrahydro-pyran-2-yloxy)-6,9,11-trihydroxy-7,8,9,10-tetrahydro-naphthacene-5,12-dione hydrochloride ID: ALA541306
PubChem CID: 45264654
Max Phase: Preclinical
Molecular Formula: C27H30ClNO9
Molecular Weight: 511.53
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COC1C(N)CC(O[C@H]2C[C@](O)(C(C)=O)Cc3c(O)c4c(c(O)c32)C(=O)c2ccccc2C4=O)OC1C.Cl
Standard InChI: InChI=1S/C27H29NO9.ClH/c1-11-26(35-3)16(28)8-18(36-11)37-17-10-27(34,12(2)29)9-15-19(17)25(33)21-20(24(15)32)22(30)13-6-4-5-7-14(13)23(21)31;/h4-7,11,16-18,26,32-34H,8-10,28H2,1-3H3;1H/t11?,16?,17-,18?,26?,27-;/m0./s1
Standard InChI Key: HUOUYAOMHPTADT-WDDHFUHDSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
8.3423 -2.7602 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-0.6089 0.2243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6089 -1.2660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9070 -2.0191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9070 0.9935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9711 -1.2660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9711 0.2243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6891 0.9935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6891 -2.0191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5671 0.2243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2050 -1.2660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2050 0.2243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2691 -2.0191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2691 0.9935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5637 -4.2738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5628 -5.7738 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5671 -1.2660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8633 -3.5247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1609 -5.7755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1619 -4.2755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8614 -6.5247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2660 -3.5199 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5383 1.7041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9070 2.1935 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.9070 -3.0191 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5028 2.3104 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6923 2.1935 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6918 -3.0191 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5874 -0.4072 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0282 -3.7761 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4586 -6.5295 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.5030 -2.0191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5030 0.9935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8606 -7.7247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5810 2.2981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4561 -7.7295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8010 -1.2660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8010 0.2243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
2 5 1 0
6 7 1 0
2 8 1 0
7 8 2 0
3 9 1 0
6 9 2 0
4 11 1 0
5 12 1 0
11 12 1 0
6 13 1 0
7 14 1 0
10 14 1 0
15 16 1 0
10 17 1 0
13 17 1 0
15 18 1 0
18 20 1 0
19 20 1 0
16 21 1 0
19 21 1 0
13 22 1 6
15 22 1 0
10 23 1 0
5 24 2 0
4 25 2 0
23 26 2 0
8 27 1 0
9 28 1 0
10 29 1 6
20 30 1 0
19 31 1 0
11 32 2 0
12 33 2 0
21 34 1 0
23 35 1 0
31 36 1 0
32 37 1 0
33 38 1 0
37 38 2 0
M END Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 511.53Molecular Weight (Monoisotopic): 511.1842AlogP: 1.67#Rotatable Bonds: 4Polar Surface Area: 165.61Molecular Species: BASEHBA: 10HBD: 4#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.02CX Basic pKa: 9.10CX LogP: 2.15CX LogD: 1.73Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.38Np Likeness Score: 1.71
References 1. Adams N, Blake C, Broadhurst MJ, Bushnell DJ, Hassall CH, Hartmann HR, Keech E, Stratton AR, Thomas GJ.. (1990) Synthesis and antitumor activity of novel 4-demethoxyanthracyclines., 33 (9): [PMID:2391681 ] [10.1021/jm00171a010 ]