Analogue X

ID: ALA606550

PubChem CID: 46878348

Max Phase: Preclinical

Molecular Formula: C22H46N6O9

Molecular Weight: 538.64

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NCCCNCC[C@H]1[C@@H](O)[C@H](O[C@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CN)[C@H](O)[C@H](O)[C@H]2N)O[C@@H]1CO

Standard InChI:  InChI=1S/C22H46N6O9/c23-3-1-4-28-5-2-9-13(8-29)35-22(15(9)30)37-20-16(31)10(25)6-11(26)19(20)36-21-14(27)18(33)17(32)12(7-24)34-21/h9-22,28-33H,1-8,23-27H2/t9-,10-,11+,12-,13-,14-,15-,16+,17+,18-,19-,20+,21-,22+/m1/s1

Standard InChI Key:  CEXPNNVGSBVLNC-SRLPDXGBSA-N

Molfile:  

     RDKit          2D

 37 39  0  0  0  0  0  0  0  0999 V2000
   -4.3018    0.6723    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9692    0.1874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7143   -0.5972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8893   -0.5972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6344    0.1874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1992   -1.2646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4044   -1.2646    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7538    0.4423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8497    0.4423    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2669    1.6868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6795    2.4013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5045    2.4013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9170    1.6868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5045    0.9723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6795    0.9723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7420    1.6868    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1545    2.4013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7420    3.1157    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1545    3.8302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9795    3.8302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3920    3.1158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9795    2.4013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3920    1.6868    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2670    0.2578    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4419    1.6868    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9170    3.1157    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7420    4.5447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3920    4.5447    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2170    3.1158    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1545    5.2592    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3669   -0.1097    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8637   -2.0183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3486   -2.6858    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0130   -3.4394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4979   -4.1069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1624   -4.8605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6473   -5.5280    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  5  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  3  6  1  6
  4  7  1  6
  2  8  1  1
  5  9  1  1
 10 11  1  0
 15 10  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 14  9  1  6
 13 16  1  6
 17 16  1  6
 17 18  1  0
 22 17  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  6
 15 24  1  6
 10 25  1  1
 12 26  1  1
 19 27  1  1
 20 28  1  1
 21 29  1  1
 27 30  1  0
  8 31  1  0
  6 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
M  END

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 538.64Molecular Weight (Monoisotopic): 538.3326AlogP: -6.07#Rotatable Bonds: 12
Polar Surface Area: 280.20Molecular Species: BASEHBA: 15HBD: 11
#RO5 Violations: 3HBA (Lipinski): 15HBD (Lipinski): 16#RO5 Violations (Lipinski): 3
CX Acidic pKa: 12.64CX Basic pKa: 10.37CX LogP: -6.66CX LogD: -14.98
Aromatic Rings: Heavy Atoms: 37QED Weighted: 0.10Np Likeness Score: 1.30

References

1. Cashman DJ, Rife JP, Kellogg GE..  (2001)  Which aminoglycoside ring is most important for binding? A hydropathic analysis of gentamicin, paromomycin, and analogues.,  11  (2): [PMID:11206440] [10.1016/s0960-894x(00)00615-6]

Source