| # | Aladdin ID | Assay Type | Description | Organism | Compounds | Reference | BAO Format | Source | |
|---|---|---|---|---|---|---|---|---|---|
| 1. | ALA839581 | A | Effect on coumarin 7-hydroxylation by human Cytochrome P-450 2A6 | Homo sapiens | 60 | ALA1145288 | single protein format | Scientific Literature | |
| 2. | ALA829411 | A | Inhibitory concentration value against human cytochrome P-450 2A6 | Homo sapiens | 25 | ALA1145288 | single protein format | Scientific Literature | |
| 3. | ALA829412 | A | Inhibitory concentration value against human cytochrome P-450 2B6 | Homo sapiens | 25 | ALA1145288 | single protein format | Scientific Literature | |
| 4. | ALA829413 | A | Inhibitory concentration against human cytochrome P-450 2C9 | Homo sapiens | 25 | ALA1145288 | single protein format | Scientific Literature | |
| 5. | ALA829414 | A | Inhibitory concentration value against human cytochrome P-450 2D6 | Homo sapiens | 25 | ALA1145288 | single protein format | Scientific Literature | |
| 6. | ALA829415 | A | Inhibitory concentration value against human cytochrome P-450 2E1 | Homo sapiens | 25 | ALA1145288 | single protein format | Scientific Literature | |
| 7. | ALA829416 | A | Inhibitory concentration value against human cytochrome P-450 3A4 | Homo sapiens | 25 | ALA1145288 | single protein format | Scientific Literature | |
| 8. | ALA827104 | A | Inhibitory concentration value against human cytochrome P-450 2C19 | Homo sapiens | 25 | ALA1145288 | single protein format | Scientific Literature | |
| 9. | ALA832584 | A | Ratio of inhibition of human cytochrome P-450 2B6 to 2A6 was determined; Expressed as IC50(CYP2B6)/IC50(CYP2A6) | Homo sapiens | 25 | ALA1145288 | assay format | Scientific Literature | |
| 10. | ALA832585 | A | Ratio of inhibition of human cytochrome P-450 2C9 to 2A6 was determined; Expressed as IC50(CYP2C9)/IC50(CYP2A6) | Homo sapiens | 24 | ALA1145288 | assay format | Scientific Literature | |
| 11. | ALA832586 | A | Ratio of inhibition of human cytochrome P-450 2D6 to 2A6 was determined; Expressed as IC50(CYP2D6)/IC50(CYP2A6) | Homo sapiens | 25 | ALA1145288 | assay format | Scientific Literature | |
| 12. | ALA832587 | A | Ratio of inhibition of human cytochrome P-450 2E1 to 2A6 was determined; Expressed as IC50(CYP2E1)/IC50(CYP2A6) | Homo sapiens | 25 | ALA1145288 | assay format | Scientific Literature | |
| 13. | ALA832588 | A | Ratio of inhibition of human cytochrome P-450 3A4 to 2A6 was determined; Expressed as IC50(CYP3A4)/IC50(CYP2A6) | Homo sapiens | 25 | ALA1145288 | assay format | Scientific Literature | |
| 14. | ALA832592 | A | Ratio of inhibition of human cytochrome P-450 2C19 to 2A6 was determined; Expressed as IC50(CYP2C19)/IC50(CYP2A6) | Homo sapiens | 25 | ALA1145288 | assay format | Scientific Literature | |
| 15. | ALA910613 | A | Stability in mouse liver microsome | Mus musculus | 29 | ALA1137358 | organism-based format | Scientific Literature | |
| 16. | ALA910614 | A | Stability in human liver microsome | Homo sapiens | 29 | ALA1137358 | microsome format | Scientific Literature | |
| 17. | ALA910617 | A | Inhibition of human CYP2A6 | Homo sapiens | 29 | ALA1137358 | single protein format | Scientific Literature | |
| 18. | ALA910618 | A | Inhibition of human CYP3A4 | Homo sapiens | 29 | ALA1137358 | single protein format | Scientific Literature | |
| 19. | ALA910038 | A | Inhibition of human CYP2E1 | Homo sapiens | 29 | ALA1137358 | single protein format | Scientific Literature | |
| 20. | ALA910039 | A | Inhibition of human CYP2C9 | Homo sapiens | 29 | ALA1137358 | single protein format | Scientific Literature |
The page will load shortly, Thanks for your patience!