| # | Aladdin ID | Assay Type | Description | Organism | Compounds | Reference | BAO Format | Source | |
|---|---|---|---|---|---|---|---|---|---|
| 1. | ALA839581 | A | Effect on coumarin 7-hydroxylation by human Cytochrome P-450 2A6 | Homo sapiens | 60 | ALA1145288 | single protein format | Scientific Literature | |
| 2. | ALA829411 | A | Inhibitory concentration value against human cytochrome P-450 2A6 | Homo sapiens | 25 | ALA1145288 | single protein format | Scientific Literature | |
| 3. | ALA829412 | A | Inhibitory concentration value against human cytochrome P-450 2B6 | Homo sapiens | 25 | ALA1145288 | single protein format | Scientific Literature | |
| 4. | ALA829413 | A | Inhibitory concentration against human cytochrome P-450 2C9 | Homo sapiens | 25 | ALA1145288 | single protein format | Scientific Literature | |
| 5. | ALA829414 | A | Inhibitory concentration value against human cytochrome P-450 2D6 | Homo sapiens | 25 | ALA1145288 | single protein format | Scientific Literature | |
| 6. | ALA829415 | A | Inhibitory concentration value against human cytochrome P-450 2E1 | Homo sapiens | 25 | ALA1145288 | single protein format | Scientific Literature | |
| 7. | ALA829416 | A | Inhibitory concentration value against human cytochrome P-450 3A4 | Homo sapiens | 25 | ALA1145288 | single protein format | Scientific Literature | |
| 8. | ALA827104 | A | Inhibitory concentration value against human cytochrome P-450 2C19 | Homo sapiens | 25 | ALA1145288 | single protein format | Scientific Literature | |
| 9. | ALA832584 | A | Ratio of inhibition of human cytochrome P-450 2B6 to 2A6 was determined; Expressed as IC50(CYP2B6)/IC50(CYP2A6) | Homo sapiens | 25 | ALA1145288 | assay format | Scientific Literature | |
| 10. | ALA832585 | A | Ratio of inhibition of human cytochrome P-450 2C9 to 2A6 was determined; Expressed as IC50(CYP2C9)/IC50(CYP2A6) | Homo sapiens | 24 | ALA1145288 | assay format | Scientific Literature | |
| 11. | ALA832586 | A | Ratio of inhibition of human cytochrome P-450 2D6 to 2A6 was determined; Expressed as IC50(CYP2D6)/IC50(CYP2A6) | Homo sapiens | 25 | ALA1145288 | assay format | Scientific Literature | |
| 12. | ALA832587 | A | Ratio of inhibition of human cytochrome P-450 2E1 to 2A6 was determined; Expressed as IC50(CYP2E1)/IC50(CYP2A6) | Homo sapiens | 25 | ALA1145288 | assay format | Scientific Literature | |
| 13. | ALA832588 | A | Ratio of inhibition of human cytochrome P-450 3A4 to 2A6 was determined; Expressed as IC50(CYP3A4)/IC50(CYP2A6) | Homo sapiens | 25 | ALA1145288 | assay format | Scientific Literature | |
| 14. | ALA832592 | A | Ratio of inhibition of human cytochrome P-450 2C19 to 2A6 was determined; Expressed as IC50(CYP2C19)/IC50(CYP2A6) | Homo sapiens | 25 | ALA1145288 | assay format | Scientific Literature | |
| 15. | ALA1614063 | B | PUBCHEM_BIOASSAY: GAPDH Dose Response Colorimetric Assay. (Class of assay: confirmatory) | Homo sapiens | 744 | ALA1201862 | single protein format | PubChem BioAssays | |
| 16. | ALA1738510 | B | PUBCHEM_BIOASSAY: SAR analysis of an In Vitro TNAP Dose Response Luminescent Assay. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID1548, AID1574, AID1577, AID1659, AID518] | Homo sapiens | 467 | ALA1201862 | single protein format | PubChem BioAssays | |
| 17. | ALA3705713 | B | Inhibition Assay: The inhibition of human CYP2A6-mediated 7-hydroxy coumarin formation was evaluated in the presence of 95 selected test compounds in a standard assay (Greenlee et al., J Pharmacol Exp Ther, 1978). Our first studies were with highly purified human CYP2A6 that provided a convenient and relatively high-throughput measure of CYP2A6 inhibition. | Homo sapiens | 89 | ALA3639082 | single protein format | BindingDB Database | |
| 18. | ALA4422401 | B | Inhibition of human CYP2A6 expressed in insect cell microsomes assessed as reduction in enzyme-mediated coumarin 7-hydroxylation | Homo sapiens | 111 | ALA4421730 | assay format | Patent Bioactivity Data | |
| 19. | ALA4422402 | B | Selectivity index, ratio of IC50 for inhibition of human CYP3A4 assessed as reduction in enzyme-mediated testosterone 6-hydroxylation to IC50 for inhibition of human CYP2A6 assessed as reduction in enzyme-mediated coumarin 7-hydroxylation | Homo sapiens | 106 | ALA4421730 | assay format | Patent Bioactivity Data | |
| 20. | ALA4422403 | A | Inhibition of CYP3A4 in human liver microsomes assessed as reduction in enzyme-mediated testosterone 6-hydroxylation in presence of NADPH-generating system, G6P and G6P dehydrogenase | Homo sapiens | 106 | ALA4421730 | microsome format | Patent Bioactivity Data |
The page will load shortly, Thanks for your patience!