The store will not work correctly when cookies are disabled.
Desacetyl Bisacodyl , CAS No.603-41-8
Basic Description
Synonyms | Dihydroxydiphenyl-pyridyl methane | Desacetyl Bisacodyl | 4,4'-Dihydroxydiphenyl(2-pyridyl)methane | DDPM | DTXCID40131544 | Q27287600 | C90507 | SCHEMBL3615825 | EC 210-039-7 | SODIUM PICOSULFATE IMPURITY B (EP IMPURITY) | SODIUM PICOSULFATE IMPURITY B [ |
Storage Temp | Store at 2-8°C |
Shipped In | Wet ice |
---|
Names and Identifiers
IUPAC Name | 4-[(4-hydroxyphenyl)-pyridin-2-ylmethyl]phenol |
INCHI | InChI=1S/C18H15NO2/c20-15-8-4-13(5-9-15)18(17-3-1-2-12-19-17)14-6-10-16(21)11-7-14/h1-12,18,20-21H |
InChi Key | LJROKJGQSPMTKB-UHFFFAOYSA-N |
Canonical SMILES | C1=CC=NC(=C1)C(C2=CC=C(C=C2)O)C3=CC=C(C=C3)O |
Isomeric SMILES | C1=CC=NC(=C1)C(C2=CC=C(C=C2)O)C3=CC=C(C=C3)O |
PubChem CID | 69046 |
Molecular Weight | 277.32 |
---|
Chemical and Physical Properties
Solubility | Methanol |
Melt Point(°C) | >200° C (dec.) |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator