| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| D266110-25mg | 25mg | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $319.90 |
| Synonyms | Bis(methyl-d3) phthalate | HY-N7106S1 | 1,2-Benzenedicarboxylic acid, di(methyl-d3) ester | A935585 | Dimethyl-d6 phthalate | Dimethyl-d6 phthalate, 98 atom % D | Q63409891 | Dimethyl phthalate-d6 | Dimethyl-d6 phthalate, analytical standard | PHTHALIC AC |
|---|---|
| Specifications & Purity | 98%，98atom%D |
| Storage Temp | Store at 2-8°C |
| Shipped In | Wet ice |
| IUPAC Name | bis(trideuteriomethyl) benzene-1,2-dicarboxylate |
|---|---|
| INCHI | InChI=1S/C10H10O4/c1-13-9(11)7-5-3-4-6-8(7)10(12)14-2/h3-6H,1-2H3/i1D3,2D3 |
| InChi Key | NIQCNGHVCWTJSM-WFGJKAKNSA-N |
| Canonical SMILES | COC(=O)C1=CC=CC=C1C(=O)OC |
| Isomeric SMILES | [2H]C([2H])([2H])OC(=O)C1=CC=CC=C1C(=O)OC([2H])([2H])[2H] |
| Alternate CAS | 131-11-3（unlabelled） |
| PubChem CID | 16212239 |
| Molecular Weight | 200.22 |
Enter Lot Number to search for COA:
| Boil Point(°C) | 282 °C (lit.) |
|---|---|
| Melt Point(°C) | 2 °C (lit.) |
F2425161