The store will not work correctly when cookies are disabled.
Dimethyldi(2-thienyl)silane , CAS No.17888-49-2
Basic Description
Synonyms | Dimethyldi(thiophen-2-yl)silane | Thiophene, 2,2'-(dimethylsilylene)bis- | Di(thien-2-yl)dimethylsilane | DIMETHYLDI(2-THIENYL)SILANE | dimethyl(dithiophen-2-yl)silane | Dimethyldi-2-thienylsilane | BS-21850 | AKOS025394467 | DTXSID90504481 | MFCD09264592 |
Shipped In | Normal |
---|
Names and Identifiers
IUPAC Name | dimethyl(dithiophen-2-yl)silane |
INCHI | InChI=1S/C10H12S2Si/c1-13(2,9-5-3-7-11-9)10-6-4-8-12-10/h3-8H,1-2H3 |
InChi Key | RPCHUCVMGSCQMP-UHFFFAOYSA-N |
Canonical SMILES | C[Si](C)(C1=CC=CS1)C2=CC=CS2 |
Isomeric SMILES | C[Si](C)(C1=CC=CS1)C2=CC=CS2 |
PubChem CID | 12617149 |
Molecular Weight | 224.42 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator