| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| D351357-1g | 1g | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $37.90 |
| Synonyms | 222739-29-9|DL-SERINE BENZYL ESTER P-TOLUENESULFONATE|Benzyl 2-amino-3-hydroxypropanoate 4-methylbenzenesulfonate|MFCD00191018|SB82688|Dl-serinebenzyl ester p-toluenesulfonate|Benzyl2-amino-3-hydroxypropanoate4-methylbenzenesulfonate|benzyl 2-amino-3-hydr |
|---|---|
| Shipped In | Normal |
| IUPAC Name | benzyl 2-amino-3-hydroxypropanoate;4-methylbenzenesulfonic acid |
|---|---|
| INCHI | InChI=1S/C10H13NO3.C7H8O3S/c11-9(6-12)10(13)14-7-8-4-2-1-3-5-8;1-6-2-4-7(5-3-6)11(8,9)10/h1-5,9,12H,6-7,11H2;2-5H,1H3,(H,8,9,10) |
| InChi Key | AKSVYZARYSSXSL-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C1=CC=C(C=C1)COC(=O)C(CO)N |
| Isomeric SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C1=CC=C(C=C1)COC(=O)C(CO)N |
| PubChem CID | 13875169 |
| Molecular Weight | 367.4 |
Enter Lot Number to search for COA:
