The store will not work correctly when cookies are disabled.
6-Ethyl-5-(4-nitrophenyl)-2,4-pyrimidinediamine , CAS No.71552-34-6
Basic Description
Synonyms | NSC372954 | NSC-372954 | 6-Ethyl-5-(4-nitrophenyl)-2,4-pyrimidinediamine | SCHEMBL6244594 | DTXSID10321293 | AKOS015965704 | MABNISKVRMEKMS-UHFFFAOYSA-N | 6-ETHYL-5-(4-NITRO-PHENYL)-PYRIMIDINE-2,4-DIAMINE | 6-ethyl-5-(4-nitrophenyl)pyrimidine-2,4-diamine |
Shipped In | Normal |
---|
Names and Identifiers
IUPAC Name | 6-ethyl-5-(4-nitrophenyl)pyrimidine-2,4-diamine |
INCHI | InChI=1S/C12H13N5O2/c1-2-9-10(11(13)16-12(14)15-9)7-3-5-8(6-4-7)17(18)19/h3-6H,2H2,1H3,(H4,13,14,15,16) |
InChi Key | MABNISKVRMEKMS-UHFFFAOYSA-N |
Canonical SMILES | CCC1=C(C(=NC(=N1)N)N)C2=CC=C(C=C2)[N+](=O)[O-] |
Isomeric SMILES | CCC1=C(C(=NC(=N1)N)N)C2=CC=C(C=C2)[N+](=O)[O-] |
PubChem CID | 341272 |
Molecular Weight | 259.26 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator