| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| E171027-1g | 1g | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $75.90 |
| Synonyms | ethyl 4-chloro-6-methylquinoline-3-carboxylate | 56824-87-4 | ETHYL4-CHLORO-6-METHYLQUINOLINE-3-CARBOXYLATE | Ethyl 4-chloro-6-methyl-quinoline-3-carboxylate | Oprea1_215174 | SCHEMBL1467189 | DTXSID10363158 | TQR0656 | GSIDXMVQPNWNIR-UHFFFAOYSA-N | MFCD00173357 | AKOS000194 |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
| IUPAC Name | ethyl 4-chloro-6-methylquinoline-3-carboxylate |
|---|---|
| INCHI | InChI=1S/C13H12ClNO2/c1-3-17-13(16)10-7-15-11-5-4-8(2)6-9(11)12(10)14/h4-7H,3H2,1-2H3 |
| InChi Key | GSIDXMVQPNWNIR-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)C1=CN=C2C=CC(=CC2=C1Cl)C |
| Isomeric SMILES | CCOC(=O)C1=CN=C2C=CC(=CC2=C1Cl)C |
| PubChem CID | 1479091 |
| Molecular Weight | 249.69 |
Enter Lot Number to search for COA:
