The store will not work correctly when cookies are disabled.
Ethyl 6-fluoro-1H-indazole-3-carboxylate , CAS No.885279-30-1
Basic Description
| Synonyms | 1H-Indazole-3-carboxylic acid, 6-fluoro-, ethyl ester | 6-Fluoro-1H-indazole-3-carboxylic acid ethyl ester | FT-0627386 | FT-0724400 | Ethyl 6-fluoro-1H-indazole-3-carboxylate | AKOS015900309 | AM20120431 | CS-0317005 | Ethyl6-fluoro-1H-indazole-3-carboxy |
|---|
| Shipped In | Normal |
|---|
Names and Identifiers
| IUPAC Name | ethyl 6-fluoro-1H-indazole-3-carboxylate |
|---|
| INCHI | InChI=1S/C10H9FN2O2/c1-2-15-10(14)9-7-4-3-6(11)5-8(7)12-13-9/h3-5H,2H2,1H3,(H,12,13) |
|---|
| InChi Key | BSZNGUIYZAUVNC-UHFFFAOYSA-N |
|---|
| Canonical SMILES | CCOC(=O)C1=NNC2=C1C=CC(=C2)F |
|---|
| Isomeric SMILES | CCOC(=O)C1=NNC2=C1C=CC(=C2)F |
|---|
| PubChem CID | 44203177 |
|---|
| Molecular Weight | 208.19 |
|---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator
