| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| F671089-1mg | 1mg | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $999.90 |
| Synonyms | Fluoroestradiol F-18 | Cerianna (TN) | 16alpha-(18F)Fluoro-17beta-estradiol | 16-.alpha.-[18F]-fluoro-17.beta. estradiol(FES) | (18F)FES | Fluorine-18 16 alpha-fluoroestradiol | 16alpha-[18F]Fluoroestradiol | Fes F-18 | FLUOROESTRADIOL F18 [MI] | F-18 16- |
|---|---|
| Mechanism of action | Diagnostic agent |
| ALogP | 3.5 |
|---|
| IUPAC Name | (8R,9S,13S,14S,16R,17R)-16-(18F)fluoranyl-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| INCHI | InChI=1S/C18H23FO2/c1-18-7-6-13-12-5-3-11(20)8-10(12)2-4-14(13)15(18)9-16(19)17(18)21/h3,5,8,13-17,20-21H,2,4,6-7,9H2,1H3/t13-,14-,15+,16-,17+,18+/m1/s1/i19-1 |
| InChi Key | KDLLNMRYZGUVMA-ZYMZXAKXSA-N |
| Canonical SMILES | CC12CCC3C(C1CC(C2O)F)CCC4=C3C=CC(=C4)O |
| Isomeric SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1C[C@H]([C@@H]2O)[18F])CCC4=C3C=CC(=C4)O |
| PubChem CID | 10869981 |
| Molecular Weight | 289.4 |
Enter Lot Number to search for COA:
