| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| F182835-1g | 1g | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $1,476.90 |
| Synonyms | E70570 | DTXSID90660672 | (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)octanedioic acid | (2S)-2-({[(9H-Fluoren-9-yl)methoxy]carbonyl}amino)octanedioic acid | FMOC-ASU-OH | CS-0205633 | AKOS025312281 | MFCD01317728 | (S)-2-(((9H-fluoren-9-yl)methoxy)c |
|---|---|
| Specifications & Purity | ≥95% |
| Shipped In | Normal |
| IUPAC Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)octanedioic acid |
|---|---|
| INCHI | InChI=1S/C23H25NO6/c25-21(26)13-3-1-2-12-20(22(27)28)24-23(29)30-14-19-17-10-6-4-8-15(17)16-9-5-7-11-18(16)19/h4-11,19-20H,1-3,12-14H2,(H,24,29)(H,25,26)(H,27,28)/t20-/m0/s1 |
| InChi Key | IMAOCPQKEUWDNC-FQEVSTJZSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CCCCCC(=O)O)C(=O)O |
| Isomeric SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCCCCC(=O)O)C(=O)O |
| PubChem CID | 44784801 |
| Molecular Weight | 411.5 |
Enter Lot Number to search for COA:
