| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| H590427-1g | 1g | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $558.90 |
| Synonyms | 3-Hydroxyisonicotinonitrile|87032-82-4|3-Hydroxypyridine-4-carbonitrile|4-PYRIDINECARBONITRILE, 3-HYDROXY-|SCHEMBL191406|DTXSID80514034|WHPBWFPVRFLVMZ-UHFFFAOYSA-N|MFCD13175206|AKOS005199116|AT12828|DS-4108|MB12322|CS-0311150|FT-0689994|EN300-119042|Z1255 |
|---|---|
| Specifications & Purity | 98% |
| Storage Temp | Store at 2-8°C,Desiccated |
| Shipped In | Wet ice |
| IUPAC Name | 3-hydroxypyridine-4-carbonitrile |
|---|---|
| INCHI | InChI=1S/C6H4N2O/c7-3-5-1-2-8-4-6(5)9/h1-2,4,9H |
| InChi Key | WHPBWFPVRFLVMZ-UHFFFAOYSA-N |
| Canonical SMILES | C1=CN=CC(=C1C#N)O |
| Isomeric SMILES | C1=CN=CC(=C1C#N)O |
| PubChem CID | 12959077 |
| Molecular Weight | 120.11 |
Enter Lot Number to search for COA:
| Pictogram(s) | GHS07 |
|---|---|
| Signal | Warning |
| Hazard Statements | H315,H319,H335,H302,H312,H332 |
| Precautionary Statements | P261,P305+P351+P338,P280,P302+P352,P321,P405,P501,P264,P271,P270,P304+P340,P403+P233,P362+P364,P330,P264+P265,P301+P317,P317,P337+P317,P332+P317,P319 |
