| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| I335402-1mg | 1mg | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $285.90 |
a labeled metabolite of Isosorbide Dinitrate
| Synonyms | Isosorbide-13C6 5-Mononitrate|1217604-00-6|[(3S,3aR,6R,6aS)-3-hydroxy-2,3,3a,5,6,6a-hexahydro(2,3,4,5-13C4)furano[3,2-b](2,3,4,5-13C4)furan-6-yl] nitrate|Isosorbide-13C6 5-Mononitrate, 90%|DTXSID70675981|AKOS030243219|J-004635|1,4:3,6-Dianhydro-5-O-nitro- |
|---|---|
| Storage Temp | Store at 2-8°C |
| Shipped In | Wet ice |
| IUPAC Name | [(3S,3aR,6R,6aS)-3-hydroxy-2,3,3a,5,6,6a-hexahydro(2,3,4,5-13C4)furano[3,2-b](2,3,4,5-13C4)furan-6-yl] nitrate |
|---|---|
| INCHI | InChI=1S/C6H9NO6/c8-3-1-11-6-4(13-7(9)10)2-12-5(3)6/h3-6,8H,1-2H2/t3-,4+,5+,6+/m0/s1/i1+1,2+1,3+1,4+1,5+1,6+1 |
| InChi Key | YWXYYJSYQOXTPL-AEKYUDOOSA-N |
| Canonical SMILES | C1C(C2C(O1)C(CO2)O[N+](=O)[O-])O |
| Isomeric SMILES | [13CH2]1[13C@@H]([13C@@H]2[13C@H](O1)[13C@@H]([13CH2]O2)O[N+](=O)[O-])O |
| PubChem CID | 46782002 |
| Molecular Weight | 197.09 |
Enter Lot Number to search for COA:
