| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| I340873-1g | 1g | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $38.90 | |
| I340873-10g | 10g | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $182.90 |
| Synonyms | Isoviolanthrone | 128-64-3 | Isodibenzanthrone | Benzo[rst]phenanthro[10,1,2-cde]pentaphene-9,18-dione | Izodibenzantron | Isothrene | Isoviolanthrone A | Benzadone Violet B | Romantrene Violet 2R | C.I. Vat Violet 10 | Vat Violet 10 | Paradone Violet B New | Paradone Brilliant |
|---|---|
| Shipped In | Normal |
| IUPAC Name | nonacyclo[18.10.2.22,5.03,16.04,13.06,11.017,31.021,26.028,32]tetratriaconta-1(30),2,4,6,8,10,13,15,17(31),18,20(32),21,23,25,28,33-hexadecaene-12,27-dione |
|---|---|
| INCHI | InChI=1S/C34H16O2/c35-33-25-7-3-1-5-17(25)19-9-11-21-24-14-16-28-32-20(18-6-2-4-8-26(18)34(28)36)10-12-22(30(24)32)23-13-15-27(33)31(19)29(21)23/h1-16H |
| InChi Key | BSIHWSXXPBAGTC-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)C3=C4C(=CC=C5C4=C(C=C3)C6=CC=C7C8=C(C=CC5=C68)C9=CC=CC=C9C7=O)C2=O |
| Isomeric SMILES | C1=CC=C2C(=C1)C3=C4C(=CC=C5C4=C(C=C3)C6=CC=C7C8=C(C=CC5=C68)C9=CC=CC=C9C7=O)C2=O |
| PubChem CID | 67189 |
| Molecular Weight | 456.5 |
| Reaxy-Rn | 2066925 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2066925&ln= |
Enter Lot Number to search for COA:
| Reaxy-Rn | 2066925 |
|---|---|
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2066925&ln= |
