| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| L335674-1g | 1g | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $142.90 |
| Synonyms | (2S,3S)-TERT-BUTYL 2-AMINO-3-METHYLPENTANOATE HCL | I0685 | MFCD00058015 | AS-31709 | L-Isoleucine tert-butyl ester HCl | tert-Butyl L-isoleucinate hydrochloride | A804296 | L-Isoleucine t-butyl ester HCl | tert-Butyl isoleucinate--hydrogen chloride (1/1) |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| IUPAC Name | tert-butyl (2S,3S)-2-amino-3-methylpentanoate;hydrochloride |
|---|---|
| INCHI | InChI=1S/C10H21NO2.ClH/c1-6-7(2)8(11)9(12)13-10(3,4)5;/h7-8H,6,11H2,1-5H3;1H/t7-,8-;/m0./s1 |
| InChi Key | IFRYMHOZFAPYPJ-WSZWBAFRSA-N |
| Canonical SMILES | CCC(C)C(C(=O)OC(C)(C)C)N.Cl |
| Isomeric SMILES | CC[C@H](C)[C@@H](C(=O)OC(C)(C)C)N.Cl |
| PubChem CID | 11687228 |
| Molecular Weight | 223.74 |
Enter Lot Number to search for COA:
