Determine the necessary mass, volume, or concentration for preparing a solution.
Synonyms | m-Cresol purple|2303-01-7|Cresol purple|3,3-Bis(4-hydroxy-2-methylphenyl)-3H-benzo[c][1,2]oxathiole 1,1-dioxide|m-Cresolsulfonphthalein|3-Cresol purple|Phenol, 4,4'-(1,1-dioxido-3H-2,1-benzoxathiol-3-ylidene)bis[3-methyl-|m-Cresolsulfonephthalein|Metacres |
---|---|
Specifications & Purity | 0.04%(w/v) in water |
Shipped In | Normal |
Product Description | (red)1.2 ~ 2.8(yellow), (yellow)7.4 ~ 9.0(purple) |
IUPAC Name | 4-[3-(4-hydroxy-2-methylphenyl)-1,1-dioxo-2,1λ6-benzoxathiol-3-yl]-3-methylphenol |
---|---|
INCHI | InChI=1S/C21H18O5S/c1-13-11-15(22)7-9-17(13)21(18-10-8-16(23)12-14(18)2)19-5-3-4-6-20(19)27(24,25)26-21/h3-12,22-23H,1-2H3 |
InChi Key | OLQIKGSZDTXODA-UHFFFAOYSA-N |
Canonical SMILES | CC1=C(C=CC(=C1)O)C2(C3=CC=CC=C3S(=O)(=O)O2)C4=C(C=C(C=C4)O)C |
Isomeric SMILES | CC1=C(C=CC(=C1)O)C2(C3=CC=CC=C3S(=O)(=O)O2)C4=C(C=C(C=C4)O)C |
WGK Germany | 3 |
PubChem CID | 73030 |
Molecular Weight | 382.43 |
Beilstein | 350314 |
Reaxy-Rn | 350314 |
Enter Lot Number to search for COA:
WGK Germany | 3 |
---|---|
Reaxy-Rn | 350314 |