The store will not work correctly when cookies are disabled.
Methyl (4-methylphenyl)cyanocarbonimidodithioate , CAS No.152381-94-7
Basic Description
Synonyms | [[(4-methylphenyl)thio]-(methylthio)methylidene]cyanamide | MFCD09877770 | A809295 | DTXSID50650211 | J-008915 | Methyl (4-methylphenyl) cyanocarbonimidodithioate | Methyl 4-methylphenyl cyanocarbonodithioimidate | Methyl(4-methylphenyl)cyanocarbonimidodi |
Shipped In | Normal |
---|
Names and Identifiers
IUPAC Name | [(4-methylphenyl)sulfanyl-methylsulfanylmethylidene]cyanamide |
INCHI | InChI=1S/C10H10N2S2/c1-8-3-5-9(6-4-8)14-10(13-2)12-7-11/h3-6H,1-2H3 |
InChi Key | GNVRJYWXSLMFHV-UHFFFAOYSA-N |
Canonical SMILES | CC1=CC=C(C=C1)SC(=NC#N)SC |
Isomeric SMILES | CC1=CC=C(C=C1)SC(=NC#N)SC |
PubChem CID | 26597998 |
Molecular Weight | 222.33 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator