| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| M120900-1g | 1g | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $1,023.90 |
| Synonyms | 55722-48-0 | Methyl 2,3,4,6-tetra-O-acetyl-beta-D-thiogalactopyranoside | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-methylsulfanyloxan-2-yl]methyl acetate | Methyl 2,3,4,6-tetra-O-acetyl- | A-D-thiogalactopyranoside | ST51037346 | SCHEMBL8424265 | DTXSID80447030 | XWFUCHLBR |
|---|---|
| Storage Temp | Store at -20°C |
| Shipped In | Ice chest + Ice pads |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-methylsulfanyloxan-2-yl]methyl acetate |
|---|---|
| INCHI | InChI=1S/C15H22O9S/c1-7(16)20-6-11-12(21-8(2)17)13(22-9(3)18)14(23-10(4)19)15(24-11)25-5/h11-15H,6H2,1-5H3/t11-,12+,13+,14-,15+/m1/s1 |
| InChi Key | XWFUCHLBRWBKGN-FQKPHLNHSA-N |
| Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)SC)OC(=O)C)OC(=O)C)OC(=O)C |
| Isomeric SMILES | CC(=O)OC[C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)SC)OC(=O)C)OC(=O)C)OC(=O)C |
| WGK Germany | 3 |
| PubChem CID | 10883373 |
| Molecular Weight | 378.39 |
Enter Lot Number to search for COA:
| WGK Germany | 3 |
|---|
