| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| M343594-5g | 5g | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $256.90 |
| Synonyms | Methyl 3,4-O-isopropylidene-L-threonate | 92973-40-5 | METHYL (2R)-2-[(4S)-2,2-DIMETHYL-1,3-DIOXOLAN-4-YL]-2-HYDROXYACETATE | 3,4-O-Isopropylidene-L-threonic acid methyl ester | SCHEMBL345922 | JSFASCPVVJBLRD-NTSWFWBYSA- | DTXSID10438875 | (R)-METHYL 2-((S)-2,2-DIMETHY |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
| Product Description | Used to prepare a dihydrofuran substrate in the total synthesis of (?)-echinosporin. |
| IUPAC Name | methyl (2R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyacetate |
|---|---|
| INCHI | InChI=1S/C8H14O5/c1-8(2)12-4-5(13-8)6(9)7(10)11-3/h5-6,9H,4H2,1-3H3/t5-,6+/m0/s1 |
| InChi Key | JSFASCPVVJBLRD-NTSWFWBYSA-N |
| Canonical SMILES | CC1(OCC(O1)C(C(=O)OC)O)C |
| Isomeric SMILES | CC1(OC[C@H](O1)[C@H](C(=O)OC)O)C |
| WGK Germany | 3 |
| PubChem CID | 10375250 |
| Molecular Weight | 190.19 |
Enter Lot Number to search for COA:
| Sensitivity | Moisture sensitive |
|---|---|
| Refractive Index | 1.446 (lit.) |
| Specific Rotation[α] | [α]20/D +18.5°, c = 2 in acetone |
| Flash Point(°F) | 210.2 °F |
| Flash Point(°C) | 99 °C |
| Boil Point(°C) | 125° C (lit.) at 12 mmHg |
| WGK Germany | 3 |
|---|---|
| RIDADR | NONHforallmodesoftransport |
