The store will not work correctly when cookies are disabled.
Methyl D-2-(4-fluorophenyl)glycinate HCl , CAS No.439213-22-6
Basic Description
Synonyms | 439213-22-6 | Methyl D-2-(4-fluorophenyl)glycinate HCl | (R)-Methyl 2-amino-2-(4-fluorophenyl)acetate hydrochloride | Methyl D-2-(4-fluorophenyl)glycinate hydrochloride | methyl (2R)-2-amino-2-(4-fluorophenyl)acetate;hydrochloride | (R)-AMINO-(4-FLUORO-PHENYL)-ACET |
Shipped In | Normal |
---|
Names and Identifiers
IUPAC Name | methyl (2R)-2-amino-2-(4-fluorophenyl)acetate;hydrochloride |
INCHI | InChI=1S/C9H10FNO2.ClH/c1-13-9(12)8(11)6-2-4-7(10)5-3-6;/h2-5,8H,11H2,1H3;1H/t8-;/m1./s1 |
InChi Key | JLGSKYIBZLQSFR-DDWIOCJRSA-N |
Canonical SMILES | COC(=O)C(C1=CC=C(C=C1)F)N.Cl |
Isomeric SMILES | COC(=O)[C@@H](C1=CC=C(C=C1)F)N.Cl |
PubChem CID | 44890845 |
Molecular Weight | 219.64 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator