The store will not work correctly when cookies are disabled.
Methyl isobutyrate - 99%, high purity , CAS No.547-63-7
Basic Description
| Synonyms | METHYL ISOBUTYRATE|547-63-7|Methyl 2-methylpropanoate|Propanoic acid, 2-methyl-, methyl ester|Methyl 2-methylpropionate|Methyl isobutanoate|Isobutyric acid, methyl ester|106989-11-1|methylisobutyrate|FEMA No. 2694|ISOBUTYRIC ACID METHYL ESTER|Methylester |
|---|
| Specifications & Purity | 99% |
|---|
| Shipped In | Normal |
|---|
Names and Identifiers
| Pubchem Sid | 488181247 |
|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488181247 |
|---|
| IUPAC Name | methyl 2-methylpropanoate |
|---|
| INCHI | InChI=1S/C5H10O2/c1-4(2)5(6)7-3/h4H,1-3H3 |
|---|
| InChi Key | BHIWKHZACMWKOJ-UHFFFAOYSA-N |
|---|
| Canonical SMILES | CC(C)C(=O)OC |
|---|
| Isomeric SMILES | CC(C)C(=O)OC |
|---|
| WGK Germany | 3 |
|---|
| RTECS | NQ5425000 |
|---|
| PubChem CID | 11039 |
|---|
| UN Number | 1237 |
|---|
| Molecular Weight | 102.13 |
|---|
| Beilstein | 1740720 |
|---|
| Reaxy-Rn | 1740720 |
|---|
Chemical and Physical Properties
| Solubility | Slightly soluble in water. |
|---|
| Sensitivity | Heat sensitive |
|---|
| Refractive Index | 1.384 |
|---|
| Flash Point(°F) | 53.6 °F |
|---|
| Flash Point(°C) | 12℃ |
|---|
| Boil Point(°C) | 90°C |
|---|
| Melt Point(°C) | -84--85°C |
|---|
Safety and Hazards(GHS)
| Pictogram(s) | GHS07, GHS02 |
|---|
| Signal | Danger |
|---|
| Hazard Statements | H225:Highly Flammable liquid and vapor H332:Harmful if inhaled |
|---|
| Precautionary Statements | P210:Keep away from heat, hot surface, sparks, open flames and other ignition sources. - No smoking. |
|---|
| WGK Germany | 3 |
|---|
| RTECS | NQ5425000 |
|---|
| Reaxy-Rn | 1740720 |
|---|
| Merck Index | 6088 |
|---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator
H2426445