The store will not work correctly when cookies are disabled.
Methylene green hemi （Zinc chloride）salt , CAS No.6722-15-2
Basic Description
| Synonyms | CHEBI:87680 | 3,7-bis(dimethylamino)-4-nitrophenothiazin-5-ium | Q27159825 | [7-(dimethylamino)-4-nitrophenothiazin-3-ylidene]-dimethylazanium | SCHEMBL2626792 |
|---|
| Storage Temp | Room temperature |
|---|
| Shipped In | Normal |
|---|
Names and Identifiers
| Pubchem Sid | 488185180 |
|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488185180 |
|---|
| IUPAC Name | [7-(dimethylamino)-4-nitrophenothiazin-3-ylidene]-dimethylazanium |
|---|
| INCHI | InChI=1S/C16H17N4O2S/c1-18(2)10-5-6-11-14(9-10)23-16-12(17-11)7-8-13(19(3)4)15(16)20(21)22/h5-9H,1-4H3/q+1 |
|---|
| InChi Key | JICGHBSILZBPAI-UHFFFAOYSA-N |
|---|
| Canonical SMILES | CN(C)C1=CC2=C(C=C1)N=C3C=CC(=[N+](C)C)C(=C3S2)[N+](=O)[O-].[Cl-] |
|---|
| Isomeric SMILES | CN(C)C1=CC2=C(C=C1)N=C3C=CC(=[N+](C)C)C(=C3S2)[N+](=O)[O-] |
|---|
| WGK Germany | 3 |
|---|
| RTECS | SP5775000 |
|---|
| PubChem CID | 75890 |
|---|
| Molecular Weight | 433 |
|---|
Chemical and Physical Properties
| Solubility | Soluble in water(10 mg/ ml-opaque, deep blue solution), and alcohol. |
|---|
Safety and Hazards(GHS)
| WGK Germany | 3 |
|---|
| RTECS | SP5775000 |
|---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator
I2425474