The store will not work correctly when cookies are disabled.
Methylene green hemi (Zinc chloride)salt , CAS No.6722-15-2
Basic Description
Synonyms | 3,7-bis(dimethylamino)-4-nitrophenothiazin-5-ium|[7-(dimethylamino)-4-nitrophenothiazin-3-ylidene]-dimethylazanium|6722-15-2|SCHEMBL2626792|CHEBI:87680|Q27159825 |
Storage Temp | Room temperature |
Shipped In | Normal |
---|
Names and Identifiers
Pubchem Sid | 488185180 |
Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488185180 |
IUPAC Name | [7-(dimethylamino)-4-nitrophenothiazin-3-ylidene]-dimethylazanium |
INCHI | InChI=1S/C16H17N4O2S/c1-18(2)10-5-6-11-14(9-10)23-16-12(17-11)7-8-13(19(3)4)15(16)20(21)22/h5-9H,1-4H3/q+1 |
InChi Key | JICGHBSILZBPAI-UHFFFAOYSA-N |
Canonical SMILES | CN(C)C1=CC2=C(C=C1)N=C3C=CC(=[N+](C)C)C(=C3S2)[N+](=O)[O-].[Cl-] |
Isomeric SMILES | CN(C)C1=CC2=C(C=C1)N=C3C=CC(=[N+](C)C)C(=C3S2)[N+](=O)[O-] |
WGK Germany | 3 |
RTECS | SP5775000 |
PubChem CID | 75890 |
Molecular Weight | 433 |
---|
Chemical and Physical Properties
Solubility | Soluble in water(10 mg/ ml-opaque, deep blue solution), and alcohol. |
Safety and Hazards(GHS)
WGK Germany | 3 |
RTECS | SP5775000 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator