| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| M333050-1mg | 1mg | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $296.90 |
| Synonyms | Metronidazole-d4 | 1261392-47-5 | 1,1,2,2-tetradeuterio-2-(2-methyl-5-nitroimidazol-1-yl)ethanol | 2-Methyl-5-nitro-1H-imidazole-1-(ethanol-d4) | Metronidazole D4 (ethylene D4) | DTXSID30678716 | HY-B0318S1 | AKOS037652763 | ES-2527 | CS-0203367 | F91172 | Metronidazole-(ethyl |
|---|---|
| Storage Temp | Store at 2-8°C |
| Shipped In | Wet ice |
| IUPAC Name | 1,1,2,2-tetradeuterio-2-(2-methyl-5-nitroimidazol-1-yl)ethanol |
|---|---|
| INCHI | InChI=1S/C6H9N3O3/c1-5-7-4-6(9(11)12)8(5)2-3-10/h4,10H,2-3H2,1H3/i2D2,3D2 |
| InChi Key | VAOCPAMSLUNLGC-RRVWJQJTSA-N |
| Canonical SMILES | CC1=NC=C(N1CCO)[N+](=O)[O-] |
| Isomeric SMILES | [2H]C([2H])(C([2H])([2H])O)N1C(=NC=C1[N+](=O)[O-])C |
| PubChem CID | 49849778 |
| Molecular Weight | 175.18 |
Enter Lot Number to search for COA:
| Melt Point(°C) | 135-137° C (dec.) |
|---|
| Pictogram(s) | GHS08 |
|---|---|
| Signal | Warning |
| Hazard Statements | H351:Suspected of causing cancer |
| Precautionary Statements | P280:Wear protective gloves/protective clothing/eye protection/face protection. P405:Store locked up. P501:Dispose of contents/container to ... P203:Obtain, read and follow all safety instructions before use. P318:if exposed or concerned, get medical advice. |
