| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| M332678-10mg | 10mg | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $285.90 |
| Synonyms | Mono-carboxy-isooctyl Phthalate|Mono-carboxy-isooctylPhthalate|Mono-carboxy isooctyl phthalate|898544-09-7|2-(8-carboxyoctan-2-yloxycarbonyl)benzoic acid|CHEBI:165210|DTXSID101028113|2-(((1-Methyl-8-carboxyheptyl)oxy)carbonyl)-benzoic Acid |
|---|---|
| Storage Temp | Store at 2-8°C |
| Shipped In | Wet ice |
| IUPAC Name | 2-(8-carboxyoctan-2-yloxycarbonyl)benzoic acid |
|---|---|
| INCHI | InChI=1S/C17H22O6/c1-12(8-4-2-3-5-11-15(18)19)23-17(22)14-10-7-6-9-13(14)16(20)21/h6-7,9-10,12H,2-5,8,11H2,1H3,(H,18,19)(H,20,21) |
| InChi Key | RCOGHDLTLRKQOP-UHFFFAOYSA-N |
| Canonical SMILES | CC(CCCCCCC(=O)O)OC(=O)C1=CC=CC=C1C(=O)O |
| Isomeric SMILES | CC(CCCCCCC(=O)O)OC(=O)C1=CC=CC=C1C(=O)O |
| PubChem CID | 145459125 |
| Molecular Weight | 322.35 |
Enter Lot Number to search for COA:
| Solubility | Soluble in DMSO (10 mg/mL), DMF (10 mg/mL), dichloromethane (5 mg/mL), and ethyl acetate (5 mg/mL). |
|---|
