| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| N184542-100g | 100g | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $1,144.90 |
| Synonyms | N-(3-CHLOROPHENYL) 3-AMINOBENZENESULFONAMIDE | 438017-93-7 | 3-amino-N-(3-chlorophenyl)benzenesulfonamide | 3-Amino-N-(3-chlorophenyl)benzene-1-sulfonamide | N-(3-Chlorophenyl)3-aminobenzenesulfonamide | 3-Amino-N-(3-chloro-phenyl)-benzenesulfonamide | DTXSID70396987 |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
| IUPAC Name | 3-amino-N-(3-chlorophenyl)benzenesulfonamide |
|---|---|
| INCHI | InChI=1S/C12H11ClN2O2S/c13-9-3-1-5-11(7-9)15-18(16,17)12-6-2-4-10(14)8-12/h1-8,15H,14H2 |
| InChi Key | FDVYFKMOPNABOK-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=CC(=C1)S(=O)(=O)NC2=CC(=CC=C2)Cl)N |
| Isomeric SMILES | C1=CC(=CC(=C1)S(=O)(=O)NC2=CC(=CC=C2)Cl)N |
| PubChem CID | 3828479 |
| Molecular Weight | 282.7 |
Enter Lot Number to search for COA:
