The store will not work correctly when cookies are disabled.
N-(3-Indolylacetyl)-DL-aspartic acid - 97%, high purity , CAS No.32449-99-3
Basic Description
Synonyms | D98CE291-68DC-4E7F-891B-9ED90D3E7D70 | SCHEMBL149555 | N-(1H-Indol-3-ylacetyl)-L-aspartic acid | N-[3-indolylacetyl]-dl-aspartic acid | 2-[[2-(1H-indol-3-yl)acetyl]amino]butanedioic acid | 2-(2-(1H-Indol-3-yl)acetamido)succinic acid | F74023 | L-N-(1H-Ind |
Specifications & Purity | ≥97% |
Storage Temp | Store at 2-8°C,Protected from light |
Shipped In | Wet ice |
---|
Names and Identifiers
IUPAC Name | 2-[[2-(1H-indol-3-yl)acetyl]amino]butanedioic acid |
INCHI | InChI=1S/C14H14N2O5/c17-12(16-11(14(20)21)6-13(18)19)5-8-7-15-10-4-2-1-3-9(8)10/h1-4,7,11,15H,5-6H2,(H,16,17)(H,18,19)(H,20,21) |
InChi Key | VAFNMNRKDDAKRM-UHFFFAOYSA-N |
Canonical SMILES | C1=CC=C2C(=C1)C(=CN2)CC(=O)NC(CC(=O)O)C(=O)O |
Isomeric SMILES | C1=CC=C2C(=C1)C(=CN2)CC(=O)NC(CC(=O)O)C(=O)O |
WGK Germany | 3 |
PubChem CID | 4656408 |
Molecular Weight | 290.27 |
---|
Chemical and Physical Properties
Sensitivity | light sensitive |
Melt Point(°C) | 198° C (dec.) |
---|
Safety and Hazards(GHS)
WGK Germany | 3 |
RIDADR | NONHforallmodesoftransport |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator