Determine the necessary mass, volume, or concentration for preparing a solution.
Basic Description
| Synonyms | N-Acetyl-DL-methionine | 1115-47-5 | Ac-DL-Met-OH | Acetyl-DL-methionine | DL-Methionine, N-acetyl- | DL-N-Acetylmethionine | METHIONINE, N-ACETYL- | Methionine, N-acetyl-, DL- | N-acetyl-D,L-methionine | N-Acetylmethionine, DL- | dl-Acetylmethionine | 2-acetamido-4-methylsulf |
|---|---|
| Specifications & Purity | 10mM in DMSO |
| Storage Temp | Store at -80°C |
| Shipped In | Ice chest + Ice pads |
Names and Identifiers
| IUPAC Name | 2-acetamido-4-methylsulfanylbutanoic acid |
|---|---|
| INCHI | InChI=1S/C7H13NO3S/c1-5(9)8-6(7(10)11)3-4-12-2/h6H,3-4H2,1-2H3,(H,8,9)(H,10,11) |
| InChi Key | XUYPXLNMDZIRQH-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)NC(CCSC)C(=O)O |
| Isomeric SMILES | CC(=O)NC(CCSC)C(=O)O |
| WGK Germany | 3 |
| RTECS | PD0500000 |
| PubChem CID | 6180 |
| Molecular Weight | 191.25 |
| Beilstein | 1867673 |
| Reaxy-Rn | 1725554 |
Certificates
Certificate of Analysis(COA)
Enter Lot Number to search for COA:
Chemical and Physical Properties
| Melt Point(°C) | 117-119°C |
|---|
Safety and Hazards(GHS)
| Pictogram(s) | GHS05 |
|---|---|
| Signal | Danger |
| Hazard Statements | H318:Causes serious eye damage |
| Precautionary Statements | P280:Wear protective gloves/protective clothing/eye protection/face protection. P264+P265:Wash hands [and …] thoroughly after handling. Do not touch eyes. P305+P354+P338:IF IN EYES: Immediately rinse with water for several minutes. Remove contact lenses if present and easy to do. Continue rinsing. P317:Get emergency medical help. |
| WGK Germany | 3 |
| RTECS | PD0500000 |
| Reaxy-Rn | 1725554 |