| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| N404368-1g | 1g | In stock | $89.90 | |
| N404368-5g | 5g | In stock | $237.90 |
| Synonyms | N',N'-diethylethane-1,2-diamine;dihydrochloride | SCHEMBL11881726 | N~1~,N~1~-Diethylethane-1,2-diamine--hydrogen chloride (1/2) | FT-0693668 | N,N-Diethyl-1,2-ethanediamine Dihydrochloride | N1,N1-Diethylethane-1,2-diamine dihydrochloride | (2-aminoethyl |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Argon charged |
| Pubchem Sid | 488201571 |
|---|---|
| IUPAC Name | N',N'-diethylethane-1,2-diamine;dihydrochloride |
| INCHI | InChI=1S/C6H16N2.2ClH/c1-3-8(4-2)6-5-7;;/h3-7H2,1-2H3;2*1H |
| InChi Key | PWLGUYGCKDLZNE-UHFFFAOYSA-N |
| Canonical SMILES | CCN(CC)CCN.Cl.Cl |
| Isomeric SMILES | CCN(CC)CCN.Cl.Cl |
| PubChem CID | 53302047 |
| Molecular Weight | 189.12 |
| Reaxy-Rn | 6598770 |
Enter Lot Number to search for COA:
| Sensitivity | Hygroscopic |
|---|---|
| Melt Point(°C) | 104 °C |
| Pictogram(s) | GHS07 |
|---|---|
| Signal | Warning |
| Hazard Statements | H315:Causes skin irritation H319:Causes serious eye irritation |
| Precautionary Statements | P305+P351+P338:IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses if present and easy to do - continue rinsing. P280:Wear protective gloves/protective clothing/eye protection/face protection. P302+P352:IF ON SKIN: wash with plenty of water. P264:Wash hands [and …] thoroughly after handling. P362:Take off contaminated clothing. P337+P313:IF eye irritation persists: Get medical advice/attention. P362+P364:Take off contaminated clothing and wash it before reuse. P332+P313:IF SKIN irritation occurs: Get medical advice/attention. |
| Reaxy-Rn | 6598770 |
A2304454