| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| O173386-1g | 1g | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $226.90 |
| Synonyms | 1-Oxaspiro[4.4]nonan-3-ol|1331825-49-0|AMY34637|MFCD30471614|AKOS030628459|SB21963|AS-52974|CS-0052413|EN300-303437|P15931 |
|---|---|
| Specifications & Purity | 97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
| IUPAC Name | 1-oxaspiro[4.4]nonan-3-ol |
|---|---|
| INCHI | InChI=1S/C8H14O2/c9-7-5-8(10-6-7)3-1-2-4-8/h7,9H,1-6H2 |
| InChi Key | IJYLVXISVKDBSA-UHFFFAOYSA-N |
| Canonical SMILES | C1CCC2(C1)CC(CO2)O |
| Isomeric SMILES | C1CCC2(C1)CC(CO2)O |
| PubChem CID | 127263526 |
| Molecular Weight | 142.198 |
Enter Lot Number to search for COA:
| Pictogram(s) | GHS07 |
|---|---|
| Signal | Warning |
| Hazard Statements | H315,H319,H335 |
| Precautionary Statements | P261,P305+P351+P338,P280,P302+P352,P321,P405,P501,P264,P271,P304+P340,P403+P233,P362+P364,P264+P265,P337+P317,P332+P317,P319 |
