| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| P331078-1g | 1g | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $79.90 |
| Synonyms | A800617 | Heptafluoro-1,1-bis(trifluoromethyl)butyl iodide | FS-4162 | SCHEMBL9868059 | 1,1,1,2,2,3,3,5,5,5-Decafluoro-2-iodo-2-(trifluoromethyl)pentane, 2-Iodoperfluoro(2-methylpentane) | AKOS016015426 | 1,1,1,2,2,3,3,5,5,5-decakis(fluoranyl)-4-iodanyl-4 |
|---|---|
| Shipped In | Normal |
| IUPAC Name | 1,1,1,2,2,3,3,5,5,5-decafluoro-4-iodo-4-(trifluoromethyl)pentane |
|---|---|
| INCHI | InChI=1S/C6F13I/c7-2(8,3(9,10)6(17,18)19)1(20,4(11,12)13)5(14,15)16 |
| InChi Key | PCOHEQOCJXXENZ-UHFFFAOYSA-N |
| Canonical SMILES | C(C(C(C(F)(F)F)(F)F)(F)F)(C(F)(F)F)(C(F)(F)F)I |
| Isomeric SMILES | C(C(C(C(F)(F)F)(F)F)(F)F)(C(F)(F)F)(C(F)(F)F)I |
| PubChem CID | 2736750 |
| Molecular Weight | 445.95 |
Enter Lot Number to search for COA:
| Boil Point(°C) | 115° |
|---|
