The store will not work correctly when cookies are disabled.
Protriptyline-d3 Hydrochloride , CAS No.1435934-21-6
Names and Identifiers
IUPAC Name | 3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)-N-(trideuteriomethyl)propan-1-amine;hydrochloride |
INCHI | InChI=1S/C19H21N.ClH/c1-20-14-6-11-19-17-9-4-2-7-15(17)12-13-16-8-3-5-10-18(16)19;/h2-5,7-10,12-13,19-20H,6,11,14H2,1H3;1H/i1D3; |
InChi Key | OGQDIIKRQRZXJH-NIIDSAIPSA-N |
Canonical SMILES | CNCCCC1C2=CC=CC=C2C=CC3=CC=CC=C13.Cl |
Isomeric SMILES | [2H]C([2H])([2H])NCCCC1C2=CC=CC=C2C=CC3=CC=CC=C13.Cl |
PubChem CID | 117065181 |
Molecular Weight | 302.86 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator