The store will not work correctly when cookies are disabled.
Reichardt′s dye - 90%, high purity , CAS No.10081-39-7
a solvatochromic betaine dye used to determine solvent polarity
Basic Description
| Synonyms | Reichardt's dye|10081-39-7|2,6-Diphenyl-4-(2,4,6-triphenyl-1-pyridinio)phenolate|Reichardt dye|2,6-diphenyl-4-(2,4,6-triphenylpyridin-1-ium-1-yl)phenolate|Reichardt's betain|Betaine 30|5'-(2,4,6-Triphenylpyridin-1-ium-1-yl)-[1,1':3',1''-terphenyl]-2'-olat |
|---|
| Specifications & Purity | 90% |
|---|
| Storage Temp | Protected from light,Store at -20°C,Argon charged |
|---|
| Shipped In | Ice chest + Ice pads |
|---|
Names and Identifiers
| IUPAC Name | 2,6-diphenyl-4-(2,4,6-triphenylpyridin-1-ium-1-yl)phenolate |
|---|
| INCHI | InChI=1S/C41H29NO/c43-41-37(31-18-8-2-9-19-31)28-36(29-38(41)32-20-10-3-11-21-32)42-39(33-22-12-4-13-23-33)26-35(30-16-6-1-7-17-30)27-40(42)34-24-14-5-15-25-34/h1-29H |
|---|
| InChi Key | UWOVWIIOKHRNKU-UHFFFAOYSA-N |
|---|
| Canonical SMILES | C1=CC=C(C=C1)C2=CC(=[N+](C(=C2)C3=CC=CC=C3)C4=CC(=C(C(=C4)C5=CC=CC=C5)[O-])C6=CC=CC=C6)C7=CC=CC=C7 |
|---|
| Isomeric SMILES | C1=CC=C(C=C1)C2=CC(=[N+](C(=C2)C3=CC=CC=C3)C4=CC(=C(C(=C4)C5=CC=CC=C5)[O-])C6=CC=CC=C6)C7=CC=CC=C7 |
|---|
| WGK Germany | 3 |
|---|
| PubChem CID | 2754438 |
|---|
| Molecular Weight | 551.68 |
|---|
| Beilstein | 1444580 |
|---|
Chemical and Physical Properties
| Solubility | Insoluble in water. |
|---|
| Sensitivity | light sensitive |
|---|
| Melt Point(°C) | 271-275° C (lit.) |
|---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator
H2413556