| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| S344647-100mg | 100mg | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $285.90 |
| Synonyms | DTXSID30192947 | L-Cysteine, S-2-benzothiazolyl- | CS-0270427 | (2R)-2-amino-3-(1,3-benzothiazol-2-ylsulfanyl)propanoic acid | SCHEMBL8963327 | S-(2-Benzothiazolyl)cysteine | s-(Benzo[d]thiazol-2-yl)-l-cysteine | S-2-Benzothiazolyl-L-cysteine | S-(2-Benzo |
|---|---|
| Shipped In | Normal |
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| IUPAC Name | (2R)-2-amino-3-(1,3-benzothiazol-2-ylsulfanyl)propanoic acid |
|---|---|
| INCHI | InChI=1S/C10H10N2O2S2/c11-6(9(13)14)5-15-10-12-7-3-1-2-4-8(7)16-10/h1-4,6H,5,11H2,(H,13,14)/t6-/m0/s1 |
| InChi Key | KRBPTLCTECPKGY-LURJTMIESA-N |
| Canonical SMILES | C1=CC=C2C(=C1)N=C(S2)SCC(C(=O)O)N |
| Isomeric SMILES | C1=CC=C2C(=C1)N=C(S2)SC[C@@H](C(=O)O)N |
| PubChem CID | 119392 |
| Molecular Weight | 254.33 |
Enter Lot Number to search for COA:
